Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
Oxalic acid dihydrate

Inventory

CAS number:
6153-56-6
Synonyms
Names:
Identifier:
common name
Oxalic acid dihydrate

Molecular and structural information

Molecular formula:
C2O4H2.2H2O
Molecular weight:
ca. 126.07
SMILES notation:
C(=O)(C(=O)O)O.O.O
InChl:
InChI=1S/C2H2O4.2H2O/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);2*1H2
Structural formula:
Chemical structure

Related substances