Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
4-methylcyclohexane-1,2-dicarboxylic acid

Inventory

CAS number:
57567-84-7
Synonyms
Names:
4-MTHPAc
4-Methylhexahydrophthalic acid
Identifier:
ChemSpider ID
CSID:84596
Identifier:
common name
4-Methyl-1,2-cyclohexanedicarboxylic acid
Identifier:
common name
4-Methylhexahydrophthalic acid
Identifier:
common name
Hexahydro-4-Methylphthalic Acid
Identifier:
PubChem
CID=93719
Identifier:
other: SMILES notation
O=C(O)C1C(C(=O)O)CC(C)CC1

Molecular and structural information

Molecular formula:
C9H14O4
Molecular weight:
186.21
SMILES notation:
CC1CCC(C(C1)C(=O)O)C(=O)O
InChl:
InChI=1S/C9H14O4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h5-7H,2-4H2,1H3,(H,10,11)(H,12,13)
Structural formula:
Chemical structure

Related substances