Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
azelaic acid

Inventory

EC number:
204-669-1
EC name:
Azelaic acid
CAS number:
123-99-9
CAS number:
123-99-9
Synonyms
Names:
1,7-Dicarboxyheptane
1,7-Heptanedicarboxylic acid
1,9-Nonanedioic acid
Azelaic acid
Nonanedioic acid
Identifier:
IUPAC name
1,7-Heptanedicarboxylic acid
Identifier:
IUPAC name
nonanedioic acid
Identifier:
other: SMILES notation
C(=O)(CCCCCCCC(=O)O)O
Identifier:
other: InChl
1S/C9H16O4/c10-8(11)6-4-2-1-3-5-7-9(12)13/h1-7H2,(H,10,11)(H,12,13)
azelaic acid

Molecular and structural information

Molecular formula:
C9H16O4
Molecular weight:
188.221
SMILES notation:
OC(=O)CCCCCCCC(=O)O
InChl:
InChI=1/C9H16O4/c10-8(11)6-4-2-1-3-5-7-9(12)13/h1-7H2,(H,10,11)(H,12,13)
Structural formula:
Chemical structure

Related substances

Categories Display