Registration Dossier

Reference substances

Reference substances

IUPAC name:
2,4-dichloro-5-isopropoxyaniline

Inventory

EC number:
255-258-9
EC name:
2,4-dichloro-5-isopropoxyaniline
CAS number:
41200-96-8
CAS number:
41200-96-8
Synonyms
Names:
2,4-dichloro-5-isopropoxyaniline
2,4-dichloro-5-isopropoxyaniline

Molecular and structural information

Molecular formula:
C9H11Cl2NO
Molecular weight:
220.096
SMILES notation:
CC(C)Oc1cc(N)c(Cl)cc1Cl
InChl:
InChI=1/C9H11Cl2NO/c1-5(2)13-9-4-8(12)6(10)3-7(9)11/h3-5H,12H2,1-2H3
Structural formula:
Chemical structure

Related substances