Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
Zinc, bis[O,O,O',O'-tetrabutyl]phosphorodithioato-κS,κS']-, (T-4)-

Inventory

Synonyms
Names:
Identifier:
common name
Neutral n-Butyl Zinc Dithiophosphate

Molecular and structural information

Molecular formula:
C16H36O4P2S4Zn (monomer), multiples for dimeric, trimeric foms etc.
Molecular weight:
548.1
SMILES notation:
CCCCOP(=S)(OCCCC)S[Zn]SP(=S)(OCCCC)OCCCC (monomer)
Structural formula:
Chemical structure

Related substances