Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2-(2-hydroxyethoxy)ethan-1-ol; 2-{[2-(2-hydroxyethoxy)ethoxy]carbonyl}benzoic acid

Inventory

Synonyms
Names:
Reaction mass of 2-{[2-(2-hydroxyethoxy)ethoxy]carbonyl}benzoic acid and 2,2'-oxydiethanol

Molecular and structural information

Molecular formula:
C12H14O6.C4H10O3
Molecular weight:
>= 106.12 - <= 254.24
SMILES notation:
C1=CC=CC(=C1C(=O)OCCOCCO)C(=O)O.C(COCCO)O
InChl:
InChI=1S/C12H14O6.C4H10O3/c13-5-6-17-7-8-18-12(16)10-4-2-1-3-9(10)11(14)15;5-1-3-7-4-2-6/h1-4,13H,5-8H2,(H,14,15);5-6H,1-4H2
Structural formula:
Chemical structure

Related substances