Registration Dossier

Diss Factsheets

IUPAC name:
sodium 2-(4-methoxybiphenyl-3-yl)hydrazinesulfonate

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C13H13N2O4SNa
Molecular weight:
ca. 316.3
SMILES notation:
COc1ccc(cc1NNS(=O)(=O)O[Na])c2ccccc2
InChl:
InChI=1/C13H14N2O4S.Na/c1-19-13-8-7-11(10-5-3-2-4-6-10)9-12(13)14-15-20(16,17)18;/h2-9,14-15H,1H3,(H,16,17,18);/q;+1/p-1
Structural formula:
Chemical structure

Related substances