Registration Dossier

Reference substances

Reference substances

IUPAC name:
1,2-dibromo-3-chloropropane

Inventory

EC number:
202-479-3
EC name:
1,2-dibromo-3-chloropropane
CAS number:
96-12-8
CAS number:
96-12-8
Synonyms
Names:
Propane, 1,2-dibromo-3-chloro-
1,2-dibromo-3-chloropropane

Molecular and structural information

Molecular formula:
C3H5Br2Cl
Molecular weight:
236.333
SMILES notation:
ClCC(Br)CBr
InChl:
InChI=1/C3H5Br2Cl/c4-1-3(5)2-6/h3H,1-2H2
Structural formula:
Chemical structure

Related substances