Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
undecanedioic acid

Inventory

EC number:
217-440-6
EC name:
Undecanedioic acid
CAS number:
1852-04-6
CAS number:
1852-04-6
Synonyms
Names:
Undecanedioic acid

Molecular and structural information

Molecular formula:
C11H20O4
Molecular weight:
216.274
SMILES notation:
OC(=O)CCCCCCCCCC(=O)O
InChl:
InChI=1/C11H20O4/c12-10(13)8-6-4-2-1-3-5-7-9-11(14)15/h1-9H2,(H,12,13)(H,14,15)
Structural formula:
Chemical structure

Related substances