Registration Dossier

Diss Factsheets

IUPAC name:
1-{[2-(2,4-Difluorophenyl)oxiran-2-yl]methyl}-1H-1,2,4-triazole monomethanesulfonate

Inventory

CAS number:
86386-77-8

Synonyms

Molecular and structural information

Molecular formula:
C12H13F2N3O4S
Molecular weight:
333
SMILES notation:
CS(=o)(=O)o.Fc1ccc(c(F)c1)C2(CO2)Cn3cncn3
Structural formula:
Chemical structure

Related substances