Registration Dossier

Diss Factsheets

IUPAC name:
3-{[4-({4-[(2-aminopropyl)amino]-6-chloro-1,3,5-triazin-2-yl}amino)-5-sulfonaphthalen-1-yl]diazenyl}naphthalene-1,5-disulfonate, disodium salt

Inventory

CAS number:
1421439-99-7

Synonyms

Molecular and structural information

Molecular formula:
C26H21ClN8Na2O9S3
Molecular weight:
767.12
SMILES notation:
[H+].[K+].[O-]S(=O)(=O)c1cc(cc2cc(c([NH3+])cc12)S([O-])(=O)=O)S([O-])(=O)=O and [K+].[K+].[O-]S(=O)(=O)c1cc(cc2cc(c([NH3+])cc12)S([O-])(=O)=O)S([O-])(=O)=O
InChl:
InChI=1/C10H9NO9S3.K/c11-8-4-7-5(2-10(8)23(18,19)20)1-6(21(12,13)14)3-9(7)22(15,16)17;/h1-4H,11H2,(H,12,13,14)(H,15,16,17)(H,18,19,20);/q;+1/p-1
Structural formula:
Chemical structure

Related substances