Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
N,N'-(2-chloro-1,4-phenylene)bis{4-[(2,5-dichlorophenyl)diazenyl]-3-hydroxy-2-naphthamide}

Inventory

EC number:
226-106-9
EC name:
N,N'-(2-chloro-1,4-phenylene)bis[4-[(2,5-dichlorophenyl)azo]-3-hydroxynaphthalene-2-carboxamide]
CAS number:
5280-78-4
CAS number:
5280-78-4

Synonyms

Molecular and structural information

Molecular formula:
C40H23Cl5N6O4
Molecular weight:
828.913
SMILES notation:
Clc7ccc(Cl)cc7N=Nc5c6ccccc6cc(C(=O)Nc4ccc(NC(=O)c3cc1ccccc1c(N=Nc2cc(Cl)ccc2Cl)c3O)cc4Cl)c5O
InChl:
InChI=1/C40H23Cl5N6O4/c41-22-9-12-29(43)33(17-22)48-50-35-25-7-3-1-5-20(25)15-27(37(35)52)39(54)46-24-11-14-32(31(45)19-24)47-40(55)28-16-21-6-2-4-8-26(21)36(38(28)53)51-49-34-18-23(42)10-13-30(34)44/h1-19,52-53H,(H,46,54)(H,47,55)
Structural formula:
Chemical structure

Related substances