Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
myristic acid

Inventory

EC number:
208-875-2
EC name:
Myristic acid
CAS number:
544-63-8
CAS number:
544-63-8
Synonyms
Names:
Tetradecanoic acid

Molecular and structural information

Molecular formula:
C14H28O2
Molecular weight:
228.371
SMILES notation:
CCCCCCCCCCCCCC(=O)O
InChl:
InChI=1/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16)
Structural formula:
Chemical structure

Related substances

Categories Display