Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
stearic acid

Inventory

EC number:
200-313-4
EC name:
Stearic acid
CAS number:
57-11-4
CAS number:
57-11-4
Synonyms
Names:
Octadecanoic acid

Molecular and structural information

Molecular formula:
C18H36O2
Molecular weight:
284.477
SMILES notation:
CCCCCCCCCCCCCCCCCC(=O)O
InChl:
InChI=1/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20)
Structural formula:
Chemical structure

Related substances

Categories Display