Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2-({3-[bis(2-hydroxyethyl)amino]propyl}[(9Z)-octadec-9-en-1-yl]amino)ethanol

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C27H56N2O3
Molecular weight:
ca. 456.7
SMILES notation:
OCCN(CCCN(CCCCCCCC/C=C\CCCCCCCC)CCO)CCO
InChl:
InChI=1S/C27H56N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-28(22-25-30)20-18-21-29(23-26-31)24-27-32/h9-10,30-32H,2-8,11-27H2,1H3/b10-9-
Structural formula:
Chemical structure

Related substances