Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2-{(3-{[2-(2-hydroxyethoxy)ethyl](2-hydroxyethyl)amino}propyl)[(9Z)-octadec-9-en-1-yl]amino}ethanol

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C29H60N2O4
Molecular weight:
ca. 500.8
SMILES notation:
OCCOCCN(CCO)CCCN(CCCCCCCC/C=C\CCCCCCCC)CCO
InChl:
InChI=1S/C29H60N2O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-30(22-25-32)20-18-21-31(23-26-33)24-28-35-29-27-34/h9-10,32-34H,2-8,11-29H2,1H3/b10-9-
Structural formula:
Chemical structure

Related substances