Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
α-phenylpiperidine-2-acetic acid

Inventory

EC number:
243-020-7
EC name:
α-phenylpiperidine-2-acetic acid
CAS number:
19395-41-6
CAS number:
19395-41-6
Synonyms
Names:
2-Piperidineacetic acid, alpha-phenyl-
phenyl(piperidin-2-yl)acetic acid

Molecular and structural information

Molecular formula:
C13H17NO2
Molecular weight:
219.28
SMILES notation:
OC(=O)C(C1CCCCN1)c2ccccc2
InChl:
InChI=1/C13H17NO2/c15-13(16)12(10-6-2-1-3-7-10)11-8-4-5-9-14-11/h1-3,6-7,11-12,14H,4-5,8-9H2,(H,15,16)
Structural formula:
Chemical structure

Related substances