Registration Dossier

IUPAC name:
(4S)-4-hydroxy-2-(3-methoxypropyl)-1,1-dioxo-3,4,4a,7a-tetrahydrothieno[3,2-e]thiazine-6-sulfonamide

Inventory

CAS number:
154127-42-1

Synonyms

Molecular and structural information

Molecular formula:
C10H18N2O6S3
Molecular weight:
ca. 358.45
SMILES notation:
COCCCN1C[C@H](C2C=C(SC2S1(=O)=O)S(=O)(=O)N)O
InChl:
1S/C10H18N2O6S3/c1-18-4-2-3-12-6-8(13)7-5-9(20(11,14)15)19-10(7)21(12,16)17/h5,7-8,10,13H,2-4,6H2,1H3,(H2,11,14,15)/t7?,8-,10?/m1/s1
Structural formula:
Chemical structure

Related substances