Registration Dossier

Diss Factsheets

IUPAC name:
3-{[ethyl(phenyl)amino]methyl}benzene-1-sulfonic acid

Inventory

EC number:
202-916-8
EC name:
α-N-ethylanilinotoluene-3-sulphonic acid
CAS number:
101-11-1
CAS number:
101-11-1

Synonyms

Molecular and structural information

Molecular formula:
C15H17NO3S
Molecular weight:
ca. 291.37
SMILES notation:
OS(=O)(=O)c2cc(CN(CC)c1ccccc1)ccc2
InChl:
InChI=1S/C15H17NO3S/c1-2-16(14-8-4-3-5-9-14)12-13-7-6-10-15(11-13)20(17,18)19/h3-11H,2,12H2,1H3,(H,17,18,19)
Structural formula:
Chemical structure

Related substances