Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
zirconium dinitrate oxide

Inventory

EC number:
237-529-3
EC name:
Zirconium dinitrate oxide
CAS number:
13826-66-9
CAS number:
13826-66-9
Synonyms
Names:
zirconium dinitrate oxide
Identifier:
CAS number
13826-66-9
Identifier:
EC name
zirconium dinitrate oxide
Identifier:
IUPAC name
Nitric acid; oxozirconium
Identifier:
IUPAC name
Zirconium dinitrate oxide
Identifier:
IUPAC name
nitric acid;oxozirconium
Identifier:
other: Molecular formula
N2O7Zr
Identifier:
other: other chemical name
bis(nitrato) oxozirconium
Identifier:
other: other chemical name
bis(nitrato-kO) oxozirconium
Identifier:
other: other chemical name
dinitratooxozirconium
Identifier:
other: other chemical name
zirconium nitrate oxide
Identifier:
other: other chemical name
zirconium oxide dinitrate
Identifier:
other: other chemical name
zirconium oxide nitrate
Identifier:
other: other chemical name
zirconium oxynitrate
Identifier:
other: other chemical name
zirconium, bis(nitrato-O) oxo-
Identifier:
other: other chemical name
zirconium, dinitratooxo-
Identifier:
other: other chemical name
zirconyl dinitrate
Identifier:
other: other chemical name
zirconyl nitrate
nitric acid; oxozirconium

Molecular and structural information

Molecular formula:
N2O7Zr
Molecular weight:
231.2
SMILES notation:
[Zr]=O.O[N+](=O)[O-].O[N+](=O)[O-]
InChl:
1S/2NO3.O.Zr/c2*2-1(3)4;;/q2*-1;;+2
Structural formula:
Chemical structure

Related substances

open allclose all
Identifier:
CAS number
Identity:
14985-18-3
Identifier:
CAS number
Identity:
55326-67-5
Identifier:
CAS number
Identity:
649568-70-7
Identifier:
CAS number
Identity:
127669-90-3
Identifier:
CAS number
Identity:
71965-17-8
Identifier:
CAS number
Identity:
39630-67-6

Categories Display