dangerous-subs-eco-labels
dangerous-subs-eco-labels
Ecolabels - Restrictions for Hazardous Substances/Mixtures
This list contains a non-exhaustive inventory of substances based on the list of hazardous substances with harmonised classification and labelling (i.e. Table 3 of Annex VI to the CLP Regulation), and the Candidate List of substances of very high concern (SVHCs). Pursuant to Article 6(6) of the EU Ecolabel Regulation, the ecolabel must not be awarded to goods containing substances or mixtures classified according to the CLP as toxic; hazardous to the environment; and carcinogenic, mutagenic, or toxic for reproduction (CMRs). Nor are products allowed the ecolabel award when they contain SVHCs (per Article 57 of REACH). While the CLP's harmonised list contains many such substances, other ones not listed in Table 3 may also meet the criteria specified for classification under the CLP.
arsenic compounds, with the exception of those specified elsewhere in this Annex
ecnumber: - casnumber: -| Table 3 of Annex VI to CLP |
yes
|
Help
Group members
substance-members-text
Results list is empty
| Name | EC / List no. | CAS no. | Association |
|---|---|---|---|
| Gallium arsenide | 215-114-8 | 1303-00-0 | diss.rml.association.type.EXPERT_ECHA |
| Tin arsenide (Sn4As3) | - | 12397-66-9 | diss.rml.association.type.EXPERT |
| Arsenenous acid, neodymium(3+) salt | - | 76871-63-1 | diss.rml.association.type.EXPERT |
| Trimanganese arsenide | 262-667-6 | 61219-26-9 | diss.rml.association.type.EXPERT_ECHA |
| Trisilver arsenite | 232-048-5 | 7784-08-9 | diss.rml.association.type.EXPERT_ECHA |
| Tetraphenylarsonium bromide | 208-069-0 | 507-27-7 | diss.rml.association.type.EXPERT |
| Glycobiarsol | 204-143-1 | 116-49-4 | diss.rml.association.type.EXPERT |
| Vanadium(4+) diarsenate (1:1) | 308-917-0 | 99035-51-5 | diss.rml.association.type.EXPERT_ECHA |
| Potassium arsenite | 236-680-2 | 13464-35-2 | diss.rml.association.type.EXPERT_ECHA |
| Boron arsenide (BAs) | - | 12005-69-5 | diss.rml.association.type.EXPERT |
| Cobalt arsenide | 248-168-6 | 27016-73-5 | diss.rml.association.type.EXPERT_ECHA |
| Zinc arsenenate oxide (Zn5(AsO3)4O3), tetrahydrate | - | 1303-39-5 | diss.rml.association.type.EXPERT |
| Arsenic chloride (AsCl) | - | 17522-78-0 | diss.rml.association.type.EXPERT |
| Bis[(2-diphenylarsinoethyl)phenyl]phosphine | 245-756-4 | 23582-05-0 | diss.rml.association.type.EXPERT |
| 4-chlorophenylarsonic acid | 226-622-4 | 5440-04-0 | diss.rml.association.type.EXPERT |
| Dimethylarsinic acid | 200-883-4 | 75-60-5 | diss.rml.association.type.EXPERT_ECHA |
| Sulfarsphenamine | 210-564-1 | 618-82-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic oxide | - | 12777-38-7 | diss.rml.association.type.EXPERT |
| Diarsenic acid | - | 13453-15-1 | diss.rml.association.type.EXPERT |
| Potassium hexafluoroarsenate | 241-102-7 | 17029-22-0 | diss.rml.association.type.EXPERT_ECHA |
| Tricadmium diarsenide | 234-484-1 | 12006-15-4 | diss.rml.association.type.EXPERT |
| Silicic acid (H4SiO4), magnesium manganese(2+) zinc salt, arsenic and lead-doped | - | 68784-76-9 | diss.rml.association.type.EXPERT |
| Arsenic sulfide | 235-720-6 | 12612-21-4 | diss.rml.association.type.EXPERT_ECHA |
| Phenylarsine oxide | 211-275-3 | 637-03-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsine, tris(2-chloroethenyl)- | - | 40334-70-1 | diss.rml.association.type.EXPERT |
| Disilver arsenide | 274-573-2 | 70333-07-2 | diss.rml.association.type.EXPERT_ECHA |
| Tris[(8α,9R)-6'-methoxycinchonan-9-ol] bis(arsenate) | 208-971-4 | 549-59-7 | diss.rml.association.type.EXPERT_ECHA |
| Acetarsol | 202-582-3 | 97-44-9 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), copper(2+) salt (1:1), sesquihydrate | - | 88442-64-2 | diss.rml.association.type.EXPERT |
| Trisilver arsenate | 236-841-7 | 13510-44-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsanilic acid | 202-674-3 | 98-50-0 | diss.rml.association.type.EXPERT |
| Disodium p-tolylarsonate | 304-956-2 | 94313-58-3 | diss.rml.association.type.EXPERT |
| 3-methyl-4-(pyrrolidin-1-yl)benzenediazonium hexafluoroarsenate | 248-532-4 | 27569-09-1 | diss.rml.association.type.EXPERT_ECHA |
| Triphenylarsine | 210-032-9 | 603-32-7 | diss.rml.association.type.EXPERT |
| Arsenic triiodide | 232-068-4 | 7784-45-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsenous acid, copper(2+) salt, hydrate, (2:3:3) | - | 73156-86-2 | diss.rml.association.type.EXPERT |
| Copper diarsenite | 240-574-1 | 16509-22-1 | diss.rml.association.type.EXPERT_ECHA |
| Disodium methylarsonate | 205-620-7 | 144-21-8 | diss.rml.association.type.EXPERT |
| Manganese arsenide (Mn2As) | - | 12005-96-8 | diss.rml.association.type.EXPERT |
| Arsine | 232-066-3 | 7784-42-1 | diss.rml.association.type.EXPERT |
| Sodium hydrogen 4-aminophenylarsonate | 204-869-9 | 127-85-5 | diss.rml.association.type.EXPERT |
| Melarsonyl potassium | 236-405-6 | 13355-00-5 | diss.rml.association.type.EXPERT |
| 2-nitrophenylarsonic acid | 226-485-0 | 5410-29-7 | diss.rml.association.type.EXPERT |
| Triethylarsine | 210-526-4 | 617-75-4 | diss.rml.association.type.EXPERT |
| Hydrogen hexafluoroarsenate | 241-128-9 | 17068-85-8 | diss.rml.association.type.EXPERT_ECHA |
| Nitarsone | 202-695-8 | 98-72-6 | diss.rml.association.type.EXPERT |
| Arsenous acid, gallium salt (1:1) | - | 24343-41-7 | diss.rml.association.type.EXPERT |
|
Flue dust, lead-refining
By-product of refining lead ores obtained from baghouse and electro-static precipitator and as slurry from scrubbers.
|
273-809-1 | 69029-67-0 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, ammonium copper salt | - | 94854-78-1 | diss.rml.association.type.EXPERT |
| Tricalcium diarsenite | 248-266-9 | 27152-57-4 | diss.rml.association.type.EXPERT_ECHA |
| Thulium arsenide | 234-482-0 | 12006-10-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic sulfide (AsS2) | - | 56320-22-0 | diss.rml.association.type.EXPERT |
| Tetraphenylarsonium chloride, compound with hydrochloric acid (1:1) | 277-208-5 | 73003-83-5 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), copper(2+) salt (4:5) | - | 89054-01-3 | diss.rml.association.type.EXPERT |
| Ethylenebis(diphenylarsine) | 224-629-7 | 4431-24-7 | diss.rml.association.type.EXPERT |
| Arsenenous acid, ammonium zinc salt | - | 94854-80-5 | diss.rml.association.type.EXPERT |
| Arsenic trichloride | 232-059-5 | 7784-34-1 | diss.rml.association.type.EXPERT_ECHA |
| 3-amino-4-hydroxyphenylarsonic acid | 218-494-3 | 2163-77-1 | diss.rml.association.type.EXPERT |
| Arsonic acid, methyl-, compd. with 1-octanamine (1:1) | - | 6379-37-9 | diss.rml.association.type.EXPERT |
| Triantimony arsenide | 235-505-7 | 12255-36-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic chloride (AsCl2) | - | 41996-37-6 | diss.rml.association.type.EXPERT |
| Arsenenous acid, lutetium(3+) salt | - | 76871-65-3 | diss.rml.association.type.EXPERT |
| Arsonic acid, disodium salt | - | 13466-06-3 | diss.rml.association.type.EXPERT |
| Triphenylsulphonium hexafluoroarsenate(1-) | 261-009-5 | 57900-42-2 | diss.rml.association.type.EXPERT_ECHA |
| Melarsoprol | 207-793-4 | 494-79-1 | diss.rml.association.type.EXPERT |
| Lithium hexafluoroarsenate | 249-963-0 | 29935-35-1 | diss.rml.association.type.EXPERT_ECHA |
| Tricalcium diarsenide | 235-509-9 | 12255-53-7 | diss.rml.association.type.EXPERT_ECHA |
| (Carboxymethyl)trimethylarsonium hydroxide inner salt | 634-697-3 | 64436-13-1 | diss.rml.association.type.EXPERT |
| Thallium arsenide | 234-481-5 | 12006-09-6 | diss.rml.association.type.EXPERT_ECHA |
| Calcium bis(dimethylarsinate) | 227-311-6 | 5785-43-3 | diss.rml.association.type.EXPERT |
| Triethyl arsenite | 221-543-1 | 3141-12-6 | diss.rml.association.type.EXPERT_ECHA |
| Proustite (Ag3(AsS3)) | 239-179-7 | 15122-58-4 | diss.rml.association.type.EXPERT |
| Sodium hydrogen [4-(acetamido)phenyl]arsonate | 209-558-1 | 585-54-6 | diss.rml.association.type.EXPERT |
| Methyl 17α-hydroxyyohimban-16α-carboxylate, methylarsonate (1:1) | 279-628-4 | 80925-03-7 | diss.rml.association.type.EXPERT |
|
Slimes and Sludges, copper-lead ore roasting off gas scrubbing, arsenic-contg.
The product obtained by the purification of copper-lead ore concentrate roasting offgas. Composed primarily of arsenic oxide (As2O3).
|
310-063-9 | 102110-62-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenopyrite, cobaltoan | - | 12414-94-7 | diss.rml.association.type.EXPERT |
| 4-(glycolloylamino)phenylarsonic acid | 205-643-2 | 144-87-6 | diss.rml.association.type.EXPERT |
| 4-(4-dimethylaminophenylazo)phenylarsonic acid | 210-750-2 | 622-68-4 | diss.rml.association.type.EXPERT |
| Cobalt arsenide (CoAs3) | - | 12256-04-1 | diss.rml.association.type.EXPERT |
| Antimony arsenate | 249-347-1 | 28980-47-4 | diss.rml.association.type.EXPERT_ECHA |
| Gallium zinc triarsenide | 308-577-3 | 98106-56-0 | diss.rml.association.type.EXPERT_ECHA |
| 4-(2-chloroacetamido)phenylarsonic acid | 226-569-7 | 5425-62-7 | diss.rml.association.type.EXPERT |
| Calcium arsenate (CaHAsO4) (6CI,7CI) | 672-782-7 | 15195-00-3 | diss.rml.association.type.EXPERT |
| Arsenenous acid, praseodymium(3+) salt | - | 86859-92-9 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), lead(2+) salt (2:3), tetrahydrate | - | 120119-64-4 | diss.rml.association.type.EXPERT |
| Arsenic acid | 231-901-9 | 7778-39-4 | diss.rml.association.type.EXPERT_ECHA |
| arsenic acid (H3AsO4), calcium salt(2:3), dihydrate | - | 30621-31-9 | diss.rml.association.type.EXPERT |
| Diarsenic tritelluride | 234-955-1 | 12044-54-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsine oxide, dichloro(2-chlorovinyl)- | - | 333-25-5 | diss.rml.association.type.EXPERT |
| Tripotassium arsenide | 234-949-9 | 12044-21-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, cobalt(2+) salt | - | 85561-28-0 | diss.rml.association.type.EXPERT |
| Diphenyliodonium hexafluoroarsenate | 263-638-0 | 62613-15-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsenous acid | - | 13464-58-9 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), magnesium salt (2:3) | - | 21480-65-9 | diss.rml.association.type.EXPERT |
|
Flue dust, arsenic-contg.
Formed when arsenic and metal oxide particles are driven off during the roasting and converting of copper concentrates and matte in the production of anode copper.
|
232-434-3 | 8028-73-7 | diss.rml.association.type.EXPERT_ECHA |
| Trinickel bis(arsenate) | 236-771-7 | 13477-70-8 | diss.rml.association.type.EXPERT_ECHA |
| 4-hydroxyphenylarsonic acid | 202-641-3 | 98-14-6 | diss.rml.association.type.EXPERT |
| Diiron arsenide | 234-474-7 | 12005-88-8 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, cadmium neodymium(3+) salt (5:1:1) | - | 76871-66-4 | diss.rml.association.type.EXPERT |
| Roxarsone | 204-453-7 | 121-19-7 | diss.rml.association.type.EXPERT_ECHA |
| 4-Aminophenylarsenoxide | - | 1122-90-3 | diss.rml.association.type.EXPERT |
| Trisodium arsenite | 236-681-8 | 13464-37-4 | diss.rml.association.type.EXPERT_ECHA |
| Calcium bis(methylarsonate) | 227-598-8 | 5902-95-4 | diss.rml.association.type.EXPERT |
| 4-acetamidophenylarsonic acid | 210-541-6 | 618-22-4 | diss.rml.association.type.EXPERT |
| o-phenylenebis(dimethylarsine) | 236-227-9 | 13246-32-7 | diss.rml.association.type.EXPERT |
| Yttrium arsenide | 235-507-8 | 12255-48-0 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), bismuth salt (1:1) | - | 13702-38-0 | diss.rml.association.type.EXPERT |
| (diphenylarsino)dimethylgallium | 302-587-1 | 94113-53-8 | diss.rml.association.type.EXPERT |
| Diarsenic pentaoxide | 215-116-9 | 1303-28-2 | diss.rml.association.type.EXPERT_ECHA |
| Disodium hydrogen 2-[[7-[(2-arsonophenyl)azo]-1,8-dihydroxy-3,6-disulphonato-2-naphthyl]azo]benzoate | 238-715-7 | 14674-83-0 | diss.rml.association.type.EXPERT |
| Arsenenous acid | - | 13768-07-5 | diss.rml.association.type.EXPERT |
| Arsonic acid, tin salt | - | 93080-00-3 | diss.rml.association.type.EXPERT |
| Arsenic(II) sulfide | - | 12044-79-0 | diss.rml.association.type.EXPERT |
| Antimony oxide (Sb2O3), mixed with arsenic oxide (As2O3) | 273-156-2 | 68951-38-2 | diss.rml.association.type.EXPERT_ECHA |
| Iron bis(arsenate) | 233-275-2 | 10102-50-8 | diss.rml.association.type.EXPERT_ECHA |
| Tribarium diarsenide | 235-508-3 | 12255-50-4 | diss.rml.association.type.EXPERT_ECHA |
| Zirconium arsenide | 262-524-8 | 60909-47-9 | diss.rml.association.type.EXPERT_ECHA |
| Silicic acid (H4SiO4), tetraethyl ester, polymer with arsenic oxide (As2O3) | - | 68957-75-5 | diss.rml.association.type.EXPERT |
| Methyl 1,2,5,6-tetrahydro-1-methylnicotinate, mono[(3-acetamido-4-hydroxyphenyl)arsonate] | 212-983-5 | 900-77-6 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), copper(2+) salt (4:1) | - | 102525-64-4 | diss.rml.association.type.EXPERT |
| Arsenenous acid, silver(1+) salt | - | 69507-43-3 | diss.rml.association.type.EXPERT |
| Tetraphenylarsonium chloride | 208-070-6 | 507-28-8 | diss.rml.association.type.EXPERT |
| Tris[(8α)-6'-methoxycinchonan-9(R)-ol] arsenite | 303-002-2 | 94138-87-1 | diss.rml.association.type.EXPERT_ECHA |
| Strychnidin-10-one, arsenite (1:1) | 309-388-9 | 100258-44-4 | diss.rml.association.type.EXPERT_ECHA |
| Diphenylarsinecarbonitrile | 245-716-6 | 23525-22-6 | diss.rml.association.type.EXPERT |
| Tricopper arsenide | 234-472-6 | 12005-75-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic sulfide | 215-117-4 | 1303-33-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), lead(2+) salt (4:5) | - | 89054-03-5 | diss.rml.association.type.EXPERT |
| Tetramethyldiarsine | 207-440-4 | 471-35-2 | diss.rml.association.type.EXPERT |
| Arsenic acid, calcium salt (1:2) | - | 13464-39-6 | diss.rml.association.type.EXPERT |
| Ammonium copper arsenate | 251-151-6 | 32680-29-8 | diss.rml.association.type.EXPERT_ECHA |
| Dibismuth tris(methylarsonate) | 286-401-3 | 85237-42-9 | diss.rml.association.type.EXPERT |
| 4-cyclohexyl-2,6-dimethylpyrylium hexafluoroarsenate | 282-701-3 | 84304-16-5 | diss.rml.association.type.EXPERT_ECHA |
| Indium arsenide | 215-115-3 | 1303-11-3 | diss.rml.association.type.EXPERT_ECHA |
| Sodium oxidoarsonous acid | - | 60189-99-3 | diss.rml.association.type.EXPERT |
| Tetraarsenic trisulfide | - | 12512-13-9 | diss.rml.association.type.EXPERT |
| Gallium arsenide phosphide | - | 106097-61-4 | diss.rml.association.type.EXPERT |
| 4-(4-aminophenylazo)phenylarsonic acid | 230-176-6 | 6966-64-9 | diss.rml.association.type.EXPERT |
| Dichromium arsenide | 235-499-6 | 12254-85-2 | diss.rml.association.type.EXPERT_ECHA |
| Trimagnesium diarsenide | 234-954-6 | 12044-49-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsonic acid, methyl-, calcium salt (1:1) | - | 6423-72-9 | diss.rml.association.type.EXPERT |
| Chlorodiphenylarsine | 211-921-4 | 712-48-1 | diss.rml.association.type.EXPERT |
| 3-formamido-4-hydroxyphenylarsonic acid | 262-085-2 | 60154-16-7 | diss.rml.association.type.EXPERT |
| Sodium hexafluoroarsenate(V) | 624-772-9 | 12005-86-6 | diss.rml.association.type.EXPERT_ECHA |
| Dichloro(phenyl)arsine | 211-791-9 | 696-28-6 | diss.rml.association.type.EXPERT |
| Trisodium arsenide | 234-952-5 | 12044-25-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), copper(2+) salt (2:3) | - | - | diss.rml.association.type.EXPERT |
| arsenic acid, calcium salt | - | 89054-07-9 | diss.rml.association.type.EXPERT |
| Iododimethylarsine | 211-630-2 | 676-75-5 | diss.rml.association.type.EXPERT |
| Trifluoroarsine | 232-060-0 | 7784-35-2 | diss.rml.association.type.EXPERT_ECHA |
| Holmium arsenide | 234-476-8 | 12005-92-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsorane, pentahydroxy-, copper(2+) salt (1:2) | - | - | diss.rml.association.type.EXPERT |
| Strontium arsenide (SrAs3) | - | 61462-16-6 | diss.rml.association.type.EXPERT |
| Iron diarsenide | 234-485-7 | 12006-21-2 | diss.rml.association.type.EXPERT_ECHA |
| Diarsenic acid, sodium salt | - | 13464-42-1 | diss.rml.association.type.EXPERT |
| Dichloro(ethyl)arsine | 209-919-3 | 598-14-1 | diss.rml.association.type.EXPERT |
| Silicic acid (H4SiO4), zinc salt (1:2), arsenic and manganese-doped | 271-895-5 | 68611-46-1 | diss.rml.association.type.EXPERT_ECHA |
| Lanthanum arsenide | 235-502-0 | 12255-04-8 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), ammonium salt (2:1) | - | 127795-79-3 | diss.rml.association.type.EXPERT |
| Strychnine dimethylarsinate | 233-973-7 | 10476-87-6 | diss.rml.association.type.EXPERT |
| 2-aminophenylarsonic acid | 218-064-5 | 2045-00-3 | diss.rml.association.type.EXPERT |
| Europium arsenide | 251-206-4 | 32775-46-5 | diss.rml.association.type.EXPERT_ECHA |
| Arsenous acid, tripotassium salt | - | 36267-15-9 | diss.rml.association.type.EXPERT |
| [4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonic acid | 227-365-0 | 5806-89-3 | diss.rml.association.type.EXPERT |
| Arsenenous acid, zinc salt | - | 10326-24-6 | diss.rml.association.type.EXPERT |
| Nickel diarsenide | 235-103-1 | 12068-61-0 | diss.rml.association.type.EXPERT_ECHA |
| Thiobis[methylarsine], anhydrosulphide | 236-436-5 | 13367-92-5 | diss.rml.association.type.EXPERT |
| Digallium arsenide phosphide | 234-948-3 | 12044-20-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid, copper(2+) salt | 249-916-4 | 29871-13-4 | diss.rml.association.type.EXPERT_ECHA |
| Tris(pentane-2,4-dionato-O,O')silicon hexafluoroarsenate | 266-621-6 | 67251-38-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsonic acid, monoammonium salt | - | 54058-01-4 | diss.rml.association.type.EXPERT |
| Samarium arsenide | 235-506-2 | 12255-39-9 | diss.rml.association.type.EXPERT_ECHA |
| Silver hexafluoroarsenate | 624-776-0 | 12005-82-2 | diss.rml.association.type.EXPERT |
| Potassium dihydrogenarsenate | 232-065-8 | 7784-41-0 | diss.rml.association.type.EXPERT_ECHA |
| Neoarsphenamine | 207-273-7 | 457-60-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, mercury(2+) salt | - | 82980-40-3 | diss.rml.association.type.EXPERT |
| Iron tris(dimethylarsinate) | 227-759-2 | 5968-84-3 | diss.rml.association.type.EXPERT |
| o-phenylenediarsonic acid | 217-154-1 | 1758-48-1 | diss.rml.association.type.EXPERT |
| Gadolinium arsenide | 234-475-2 | 12005-89-9 | diss.rml.association.type.EXPERT_ECHA |
| Nickel arsenide | 248-169-1 | 27016-75-7 | diss.rml.association.type.EXPERT_ECHA |
| Tristrontium diarsenide | 254-407-5 | 39297-24-0 | diss.rml.association.type.EXPERT_ECHA |
| [2-(diphenylarsino)ethyl]diphenylphosphine | 245-758-5 | 23582-06-1 | diss.rml.association.type.EXPERT |
| Arsenic chloride | - | 37226-49-6 | diss.rml.association.type.EXPERT |
| Arsenic selenide | - | 12626-31-2 | diss.rml.association.type.EXPERT |
| ARSENIC(V) OXIDE HYDRATE | 629-626-8 | 12044-50-7 | diss.rml.association.type.EXPERT |
| Trisodium 4-[(o-arsonophenyl)azo]-3-oxidonaphthalene-2,7-disulphonate | 258-693-2 | 53669-45-7 | diss.rml.association.type.EXPERT |
| Tristrontium diarsenate | 236-684-4 | 13464-68-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, lithium salt | - | 72845-34-2 | diss.rml.association.type.EXPERT |
| Calcium arsenate fluoride | - | 17068-86-9 | diss.rml.association.type.EXPERT |
| Arsenous acid, iron(3+) salt (1:1) | - | 60168-33-4 | diss.rml.association.type.EXPERT |
| Tin arsenide (SnAs) | - | 12044-32-5 | diss.rml.association.type.EXPERT |
| Arsenic acid, (H3-As-O4), lead(4+) salt (4:3) | - | 53404-12-9 | diss.rml.association.type.EXPERT |
| trisodium;trioxido(oxo)-$l^{5}-arsane;dodecahydrate | - | 13510-46-8 | diss.rml.association.type.EXPERT |
| Antimony arsenic oxide | 264-904-9 | 64475-90-7 | diss.rml.association.type.EXPERT_ECHA |
| Sodium hydrogen (3-acetamido-4-hydroxyphenyl)arsonate | 227-573-1 | 5892-48-8 | diss.rml.association.type.EXPERT |
| Sodium p-arsonobenzenesulphonate | 229-632-7 | 6634-88-4 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), dipotassium salt | - | 21093-83-4 | diss.rml.association.type.EXPERT |
| Arsenic tetrasulfide | - | 56729-51-2 | diss.rml.association.type.EXPERT |
| Arsine, dichloromethyl- | 695-189-5 | 593-89-5 | diss.rml.association.type.EXPERT |
| Gallium arsenic phosphide | - | 60953-19-7 | diss.rml.association.type.EXPERT |
| Copper arsonate | 233-644-8 | 10290-12-7 | diss.rml.association.type.EXPERT |
| Strontium arsenite (Sr(As2O4)) | - | 91724-16-2 | diss.rml.association.type.EXPERT |
| Arsenic sulfide (As2S5) | 625-728-1 | 1303-34-0 | diss.rml.association.type.EXPERT |
| Trisodium 2-(-hydrogen arsonatophenylazo)-1,8-dihydroxynaphthalene-3,6-disulphonate | 208-285-5 | 520-10-5 | diss.rml.association.type.EXPERT |
| 10-[(dimethylthiocarbamoyl)thio]-5,10-dihydrophenarsazine | 225-368-1 | 4808-24-6 | diss.rml.association.type.EXPERT |
| Diphenyldiarsenic acid | 224-845-1 | 4519-32-8 | diss.rml.association.type.EXPERT_ECHA |
| Zinc arsenate | 236-683-9 | 13464-44-3 | diss.rml.association.type.EXPERT_ECHA |
| Nickel arsenide | - | 12795-30-1 | diss.rml.association.type.EXPERT |
| Trimethylarsine | 209-815-8 | 593-88-4 | diss.rml.association.type.EXPERT |
| Platinum arsenide (PtAs2) | - | 12044-52-9 | diss.rml.association.type.EXPERT |
| Lead arsenite | 233-083-9 | 10031-13-7 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, cadmium salt | - | 84953-43-5 | diss.rml.association.type.EXPERT |
| Sodium 4-(glycolloylamino)phenylarsonate | 231-680-9 | 7681-83-6 | diss.rml.association.type.EXPERT |
| Arsenic acid, magnesium salt | 233-285-7 | 10103-50-1 | diss.rml.association.type.EXPERT_ECHA |
| Disodium 3-[(o-arsonophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 222-600-3 | 3547-38-4 | diss.rml.association.type.EXPERT |
| 2,6-dimethyl-4-(1-naphthyl)pyrylium hexafluoroarsenate | 282-682-1 | 84282-36-0 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic bromide | 265-296-8 | 64973-06-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), lead(4+) salt (3:2) | - | 10102-48-4 | diss.rml.association.type.EXPERT |
| Diarsenic triselenide | 215-119-5 | 1303-36-2 | diss.rml.association.type.EXPERT_ECHA |
| Trisodium arsenate | 236-682-3 | 13464-38-5 | diss.rml.association.type.EXPERT_ECHA |
| Pentahydroxyarsorane | 232-096-7 | 7786-36-9 | diss.rml.association.type.EXPERT_ECHA |
| Diphenylarsine | 212-589-3 | 829-83-4 | diss.rml.association.type.EXPERT |
| Potassium arsonate | 233-337-9 | 10124-50-2 | diss.rml.association.type.EXPERT |
| [No public or meaningful name is available] | - | 16973-45-8 | diss.rml.association.type.EXPERT |
| 2,7-(bis(2-arsonophenylazo))-1,8-dihydroxynaphthalene-3,6-disulphonic acid | 216-788-6 | 1668-00-4 | diss.rml.association.type.EXPERT |
| Leucomycin V, 9-O-[5-(dimethylamino)tetrahydro-6-methyl-2H-pyran-2-yl]-, [9(5S,6R)]-, [1,2-ethanediylbis(imino-4,1-phenylene)]bis[arsonate] (1:1) (salt) | 299-051-1 | 93841-79-3 | diss.rml.association.type.EXPERT |
| Trisilver arsenide | 235-652-7 | 12417-99-1 | diss.rml.association.type.EXPERT_ECHA |
| Triethyl arsenate | 427-700-2 | 15606-95-8 | diss.rml.association.type.EXPERT |
| Dysprosium arsenide | 234-473-1 | 12005-81-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid, tripotassium salt | - | 13464-36-3 | diss.rml.association.type.EXPERT |
| Iron arsenate | 233-274-7 | 10102-49-5 | diss.rml.association.type.EXPERT_ECHA |
| Tetraphenylarsonium Chloride Hydrochloride Hydrate | 621-302-4 | 123334-18-9 | diss.rml.association.type.EXPERT |
| Tribarium diarsenate | 236-762-8 | 13477-04-8 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic tribromide | 232-057-4 | 7784-33-0 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, cerium(3+) salt | - | 86859-93-0 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), calcium salt (7:10) | - | 85949-61-7 | diss.rml.association.type.EXPERT |
| Boron arsenate | - | 13510-31-1 | diss.rml.association.type.EXPERT |
| Sodium cacodylate trihydrate | 682-793-9 | 6131-99-3 | diss.rml.association.type.EXPERT_ECHA |
| Strychnine arsenate | 233-970-0 | 10476-82-1 | diss.rml.association.type.EXPERT_ECHA |
| Boron arsenide (B6As) | - | 12005-70-8 | diss.rml.association.type.EXPERT |
| Trilithium arsenate | 236-773-8 | 13478-14-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), monosodium salt | - | 10103-60-3 | diss.rml.association.type.EXPERT |
| Benzenesulfonic acid, 4-arsenoso- | - | 71130-51-3 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), monopotassium salt, 1/5hydrate | - | 164170-84-7 | diss.rml.association.type.EXPERT |
| Arsenic tetrachloride fluoride | - | 87198-15-0 | diss.rml.association.type.EXPERT |
| Bromo(hydroxytetraphenylarsoranato)magnesium | 264-254-6 | 63468-73-5 | diss.rml.association.type.EXPERT |
| Difetarsone | 222-866-0 | 3639-19-8 | diss.rml.association.type.EXPERT |
| Zinc diarsenide | 234-956-7 | 12044-55-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic | 231-148-6 | 7440-38-2 | diss.rml.association.type.EXPERT_ECHA |
| Aluminium gallium arsenide | 680-872-2 | 37382-15-3 | diss.rml.association.type.EXPERT |
| Cobalt arsenide | 265-784-0 | 65453-05-6 | diss.rml.association.type.EXPERT_ECHA |
| Tri-p-tolylarsine | 220-776-6 | 2896-10-8 | diss.rml.association.type.EXPERT |
| Arsenenous acid, antimony(3+) salt | - | 83877-96-7 | diss.rml.association.type.EXPERT |
| Sodium metaarsenate | 239-171-3 | 15120-17-9 | diss.rml.association.type.EXPERT_ECHA |
| Erbium arsenide | 235-501-5 | 12254-88-5 | diss.rml.association.type.EXPERT_ECHA |
| Triammonium arsenate | 246-428-3 | 24719-13-9 | diss.rml.association.type.EXPERT_ECHA |
| Calcium arsenate | 231-904-5 | 7778-44-1 | diss.rml.association.type.EXPERT_ECHA |
| Methylarsonic acid | 204-705-6 | 124-58-3 | diss.rml.association.type.EXPERT |
| Germanium arsenide | 235-547-6 | 12271-72-6 | diss.rml.association.type.EXPERT_ECHA |
| Methyldiphenylarsine | 213-414-3 | 945-48-2 | diss.rml.association.type.EXPERT |
| (4-aminophenyl)arsonic acid, compound with piperazine (1:1) | 303-952-8 | 94232-26-5 | diss.rml.association.type.EXPERT |
| Lead hydrogen arsenate | 232-064-2 | 7784-40-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, nickel(2+) salt | - | 33992-49-3 | diss.rml.association.type.EXPERT |
| Arsenic acid, calcium salt | 233-287-8 | 10103-62-5 | diss.rml.association.type.EXPERT_ECHA |
| Diphenoxarsin-10-yl oxide | 200-377-3 | 58-36-6 | diss.rml.association.type.EXPERT |
| Disodium [4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonate | 222-749-4 | 3599-28-8 | diss.rml.association.type.EXPERT |
| Arsenous acid, zinc salt (2:3) | - | 28837-97-0 | diss.rml.association.type.EXPERT |
| Copper acetoarsenite | 601-658-7 | 12002-03-8 | diss.rml.association.type.EXPERT |
| 2,6-dimethyl-4-phenylpyrylium hexafluoroarsenate | 282-700-8 | 84304-15-4 | diss.rml.association.type.EXPERT_ECHA |
| Chlorotris(triphenylarsine)rhodium | 239-051-0 | 14973-92-3 | diss.rml.association.type.EXPERT |
| Trisodium 3-[(o-arsonatophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 266-069-6 | 66019-20-3 | diss.rml.association.type.EXPERT |
| Arsonic acid, [4-[[4-(dimethylamino)phenyl]azo]phenyl]-, monohydrochloride | 620-678-7 | 73688-85-4 | diss.rml.association.type.EXPERT |
| Tetraphenylarsonium (hydrogen dichloride) | 244-144-4 | 21006-73-5 | diss.rml.association.type.EXPERT |
| Disodium 4-[(o-arsonophenyl)azo]-3-hydroxynaphthalene-2,7-disulphonate | 222-993-1 | 3688-92-4 | diss.rml.association.type.EXPERT_ECHA |
| Disodium arsonoacetate | 204-806-5 | 126-82-9 | diss.rml.association.type.EXPERT |
| Terbium arsenide | 234-479-4 | 12006-08-5 | diss.rml.association.type.EXPERT_ECHA |
| Cobalt arsenide (CoAs2) | - | 12044-42-7 | diss.rml.association.type.EXPERT |
| Arsenenic acid | - | 10102-53-1 | diss.rml.association.type.EXPERT |
| Tritylium hexafluoroarsenate | 207-111-5 | 437-15-0 | diss.rml.association.type.EXPERT_ECHA |
| Praseodymium arsenide | 234-953-0 | 12044-28-9 | diss.rml.association.type.EXPERT_ECHA |
| Thallium triarsenide | 281-902-3 | 84057-85-2 | diss.rml.association.type.EXPERT_ECHA |
| Triphenylarsine oxide | 214-571-0 | 1153-05-5 | diss.rml.association.type.EXPERT |
| Arsenazo III sodium | 630-782-4 | 138608-19-2 | diss.rml.association.type.EXPERT |
| Sodium hydrogen allylarsonate | 304-710-4 | 94278-22-5 | diss.rml.association.type.EXPERT |
| Arsenous acid, antimony(3+) salt (1:1) | - | 12523-20-5 | diss.rml.association.type.EXPERT |
| 4-[(2-arsonophenyl)azo]-3-hydroxynaphthalene-2,7-disulphonic acid | 205-058-2 | 132-33-2 | diss.rml.association.type.EXPERT |
| Zinc arsenide | - | 56450-43-2 | diss.rml.association.type.EXPERT |
| Arsenous acid, tricopper(1+) salt | - | 33382-64-8 | diss.rml.association.type.EXPERT |
| Arsenous acid, titanium salt | - | 92278-94-9 | diss.rml.association.type.EXPERT |
|
Lead, antimonial, dross
A scum formed on the surface of antimonial lead. Consists primarily of sodium arsenate and sodium antimonate with some lead oxide and free caustic soda.
|
273-795-7 | 69029-51-2 | diss.rml.association.type.EXPERT_ECHA |
| Iron arsenide | 234-947-8 | 12044-16-5 | diss.rml.association.type.EXPERT_ECHA |
| Neodymium arsenide | 235-504-1 | 12255-09-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, manganese(2+) salt | - | 85561-29-1 | diss.rml.association.type.EXPERT |
| Methylenebis(diphenylarsine) | 244-639-5 | 21892-63-7 | diss.rml.association.type.EXPERT |
| Carbarsone | 204-484-6 | 121-59-5 | diss.rml.association.type.EXPERT |
| Calcium arsenite | 258-147-3 | 52740-16-6 | diss.rml.association.type.EXPERT |
| Arsenic acid, sodium salt | 231-547-5 | 7631-89-2 | diss.rml.association.type.EXPERT_ECHA |
| Diarsenic trioxide | 215-481-4 | 1327-53-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, cesium salt | - | 82005-78-5 | diss.rml.association.type.EXPERT |
| 6,6'-dihydroxy-3,3'-diarsene-1,2-diyldianilinium dichloride | 205-386-6 | 139-93-5 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), magnesium salt, manganese-doped | 310-019-9 | 102110-21-4 | diss.rml.association.type.EXPERT_ECHA |
| (4-((2-Amino-2-oxoethyl)amino)phenyl)arsonic acid | - | 618-25-7 | diss.rml.association.type.EXPERT |
| 10-chloro-5,10-dihydrophenarsazine | 209-433-1 | 578-94-9 | diss.rml.association.type.EXPERT |
|
Slimes and Sludges, copper refining
A complex combination resulting from copper processing---other than electrolytic.
|
266-977-2 | 67712-00-9 | diss.rml.association.type.EXPERT_ECHA |
| Benzenesulfonic acid, 4-arsenoso-, sodium salt | - | 71130-50-2 | diss.rml.association.type.EXPERT |
| Manganese arsenate | - | 27526-45-0 | diss.rml.association.type.EXPERT |
| Arsenic pentachloride | - | 22441-45-8 | diss.rml.association.type.EXPERT |
| Disodium 3,6-bis[(o-arsonophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 263-516-7 | 62337-00-2 | diss.rml.association.type.EXPERT_ECHA |
| 4-(diethylamino)-2-ethoxybenzenediazonium hexafluoroarsenate | 264-027-1 | 63217-33-4 | diss.rml.association.type.EXPERT_ECHA |
| Acetarsol sodium | 259-714-8 | 55588-51-7 | diss.rml.association.type.EXPERT |
| Tripotassium arsenate 3/2hydrate | - | 62702-52-7 | diss.rml.association.type.EXPERT |
| 2-[[7-[(2-arsonophenyl)azo]-1,8-dihydroxy-3,6-disulpho-2-naphthyl]azo]benzoic acid | 223-216-9 | 3772-44-9 | diss.rml.association.type.EXPERT |
| Aluminium arsenide | 245-255-0 | 22831-42-1 | diss.rml.association.type.EXPERT_ECHA |
| Methyltriphenylarsonium iodide | 216-108-8 | 1499-33-8 | diss.rml.association.type.EXPERT |
| Allylarsonic acid | 209-678-4 | 590-34-1 | diss.rml.association.type.EXPERT |
| Arsenic trichloride | - | 60646-36-8 | diss.rml.association.type.EXPERT |
| Ferric arsenite, basic | - | 63989-69-5 | diss.rml.association.type.EXPERT |
| Acetarsol--diethylamine (1:1) | 208-597-1 | 534-33-8 | diss.rml.association.type.EXPERT |
| Arsthinol | 204-361-7 | 119-96-0 | diss.rml.association.type.EXPERT |
| Sodium dioxoarsenate | 232-070-5 | 7784-46-5 | diss.rml.association.type.EXPERT_ECHA |
| Niobium arsenide | 235-503-6 | 12255-08-2 | diss.rml.association.type.EXPERT_ECHA |
| Iron arsenide | - | 39310-41-3 | diss.rml.association.type.EXPERT |
| Pentafluoroarsorane | 232-061-6 | 7784-36-3 | diss.rml.association.type.EXPERT_ECHA |
| Ytterbium arsenide | 234-483-6 | 12006-12-1 | diss.rml.association.type.EXPERT_ECHA |
| Phenylarsonic acid | 202-631-9 | 98-05-5 | diss.rml.association.type.EXPERT |
| Disodium 3-[[2-[(dihydroxyarsino)oxy]phenyl]azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 282-454-1 | 84215-48-5 | diss.rml.association.type.EXPERT |
| Bis(pentane-2,4-dionato-O,O')boron(1+) hexafluoroarsenate(1-) | 272-591-5 | 68892-01-3 | diss.rml.association.type.EXPERT_ECHA |
| Sodium hydrogen [4-[(hydroxyacetyl)amino]phenyl]arsonate | 205-415-2 | 140-45-4 | diss.rml.association.type.EXPERT |
| Arsenic acid, copper salt | 233-286-2 | 10103-61-4 | diss.rml.association.type.EXPERT_ECHA |
| 4-(ethylamino)-2-methylbenzenediazonium hexafluoroarsenate | 264-026-6 | 63217-32-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), copper(2+) salt (1:1) | - | 13464-31-8 | diss.rml.association.type.EXPERT |
| Sodium methylarsonate | 218-495-9 | 2163-80-6 | diss.rml.association.type.EXPERT |
| Arsenious acid (HAsO2), strontium salt | - | 15195-06-9 | diss.rml.association.type.EXPERT |
| Rammelsbergite (NiAs2) | - | 1303-22-6 | diss.rml.association.type.EXPERT |
| p-tolylarsonic acid | 223-588-2 | 3969-54-8 | diss.rml.association.type.EXPERT |
| [No public or meaningful name is available] | - | 37337-11-4 | diss.rml.association.type.EXPERT |
| 2,2'-[ethylenebis(oxy)]bis[1,3,2-dioxarsolane] | 238-911-2 | 14849-23-1 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), lead salt | - | 7645-25-2 | diss.rml.association.type.EXPERT |
| Ammonium dihydrogenarsenate | 236-667-1 | 13462-93-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, calcium salt (2:1) | - | 15194-98-6 | diss.rml.association.type.EXPERT |
| Manganese hydrogenarsenate | 232-063-7 | 7784-38-5 | diss.rml.association.type.EXPERT_ECHA |
| Arsonic acid, methyl-, iron salt (9CI) | - | 33972-75-7 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), calcium salt (4:5) | - | 89067-81-2 | diss.rml.association.type.EXPERT |
| Tricobalt diarsenate | 246-429-9 | 24719-19-5 | diss.rml.association.type.EXPERT_ECHA |
| Sodium arsenate dibasic heptahydrate | 677-900-0 | 10048-95-0 | diss.rml.association.type.EXPERT_ECHA |
| Diammonium hydrogenarsenate | 232-067-9 | 7784-44-3 | diss.rml.association.type.EXPERT_ECHA |
| Diiodo(phenyl)arsine | 228-965-5 | 6380-34-3 | diss.rml.association.type.EXPERT |
| Methyloxoarsine | 209-799-2 | 593-58-8 | diss.rml.association.type.EXPERT |
| Sodium dimethylarsinate | 204-708-2 | 124-65-2 | diss.rml.association.type.EXPERT_ECHA |
|
Slimes and Sludges, copper electrolytic refining, decopperized, arsenic-rich
Product obtained by centrifuging the slime discharged at the bases of cells for decopperization of electrolytic copper solutions. Composed primarily of a copper powder rich in arsenic.
|
309-772-6 | 100995-81-1 | diss.rml.association.type.EXPERT_ECHA |
| Tetraarsenic tetrasulfide | - | 12279-90-2 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), cobalt(2+) salt | - | 29871-10-1 | diss.rml.association.type.EXPERT |
| Lutetium arsenide | 234-477-3 | 12005-94-6 | diss.rml.association.type.EXPERT_ECHA |
| (2-Chloroethenyl)arsonous dichloride | - | 541-25-3 | diss.rml.association.type.EXPERT |
| Arsenous acid, lead(2+) salt (1:1) | - | 100822-74-0 | diss.rml.association.type.EXPERT |
| Disodium hydrogenarsenate | 231-902-4 | 7778-43-0 | diss.rml.association.type.EXPERT_ECHA |
| Tryparsamide | 209-070-9 | 554-72-3 | diss.rml.association.type.EXPERT |
| Oxophenarsine hydrochloride | 208-682-3 | 538-03-4 | diss.rml.association.type.EXPERT_ECHA |
| iron;iron(3+);methyl-dioxido-oxo-$l^{5}-arsane | - | 6585-53-1 | diss.rml.association.type.EXPERT |
| Oxophenarsine | 206-178-8 | 306-12-7 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic disulfide | 627-949-9 | 1303-32-8 | diss.rml.association.type.EXPERT |
| Arsonic acid, lead(2+) salt (1:1) | - | 109882-46-4 | diss.rml.association.type.EXPERT |
| Propylarsonic acid | 203-482-2 | 107-34-6 | diss.rml.association.type.EXPERT |
| Arsonate | - | 36465-76-6 | diss.rml.association.type.EXPERT |
| Mercury hydrogenarsenate | 232-062-1 | 7784-37-4 | diss.rml.association.type.EXPERT_ECHA |
| Sodium p-[[4-[3-(2-arsono-4-nitrophenyl)triazen-1-yl]phenyl]azo]benzenesulphonate | 217-197-6 | 1772-02-7 | diss.rml.association.type.EXPERT |
| N-(p-arsenosophenyl)-1,3,5-triazine-2,4,6-triamine | 244-612-8 | 21840-08-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, rubidium salt | - | 85906-44-1 | diss.rml.association.type.EXPERT |
| Disodium 3,6-bis[[2-[(dihydroxyarsino)oxy]phenyl]azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 282-453-6 | 84215-47-4 | diss.rml.association.type.EXPERT |
| Manganese arsenide | 234-478-9 | 12005-95-7 | diss.rml.association.type.EXPERT_ECHA |
| Trizinc diarsenide | 234-486-2 | 12006-40-5 | diss.rml.association.type.EXPERT_ECHA |
| Magnesium arsenate, decahydrate | - | 117746-50-6 | diss.rml.association.type.EXPERT |
| Strychnidin-10-one, compd. with methylarsonate (1:1) | 279-614-8 | 80879-64-7 | diss.rml.association.type.EXPERT |
| 10-chloro-10H-phenoxarsine | 220-684-6 | 2865-70-5 | diss.rml.association.type.EXPERT |
| Trilead diarsenate | 222-979-5 | 3687-31-8 | diss.rml.association.type.EXPERT_ECHA |
| Difetarsone disodium | 208-209-0 | 515-76-4 | diss.rml.association.type.EXPERT |
| Arsenic sulfide (As2S4) | - | - | diss.rml.association.type.EXPERT |
| ARSENIC ACID (H3ASO4), HEMIHYDRATE | - | 7774-41-6 | diss.rml.association.type.EXPERT |
| Trilithium arsenide | 234-950-4 | 12044-22-3 | diss.rml.association.type.EXPERT_ECHA |
| Ammonium magnesium arsenate | - | 14644-70-3 | diss.rml.association.type.EXPERT |
|
Lead alloy, base, dross
A scum formed on the surface of molten lead-base alloys. Includes those cases in which aluminum is used to remove arsenic, nickel and antimony.
|
273-700-9 | 69011-59-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), lead(4+) salt (2:1), monohydrate | - | 33940-95-3 | diss.rml.association.type.EXPERT |
| Arsine, bis(2-chlorovinyl)chloro- | - | 40334-69-8 | diss.rml.association.type.EXPERT |
| Zinc arsenate, octahydrate | - | 13510-72-0 | diss.rml.association.type.EXPERT |
EU Privacy Disclaimer
This website uses cookies to ensure you get the best experience on our websites.