Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
6-({[4-(prop-2-enoyloxy)butoxy]carbonyl}oxy)naphthalene-2-carboxylic acid

Inventory

CAS number:
914917-99-0
Synonyms
Names:
NABC acid
NABC-Saeure
Naphthoic-2- acid, 6-[[[4-[(1-oxo-2-propen-1-yl)oxy]butoxy]carbonyl]oxy]

Molecular and structural information

Molecular formula:
C19H18O7
Molecular weight:
358
SMILES notation:
C=CC(=O)OCCCCOC(=O)Oc2ccc1cc(C(=O)O)ccc1c2
Structural formula:
Chemical structure

Related substances