Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
(7R)-4-(5-Chloro-1,3-benzoxazol-2-yl)-7-methyl-1,4-diazepan-1-ium chloride

Inventory

CAS number:
1266664-66-7
Synonyms
Names:
Identifier:
other:
Amine HCl salt
(7R)-4-(5-Chloro-1,3-benzoxazol-2-yl)-7-methyl-1,4-diazepan-1-ium chloride

Molecular and structural information

Molecular formula:
C13H17Cl2N3O
Molecular weight:
ca. 302.2
SMILES notation:
ClC1=CC=C(OC(N2CC[C@@H](C)NCC2)=N3)C3=C1.Cl
Structural formula:
Chemical structure

Related substances