Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
1,2-difluoro-4-nitrobenzene

Inventory

EC number:
206-718-2
EC name:
1,2-difluoro-4-nitrobenzene
CAS number:
369-34-6
CAS number:
369-34-6
Synonyms
Names:
1,2-difluoro-4-nitrobenzene

Molecular and structural information

Molecular formula:
C6H3F2NO2
Molecular weight:
159.09
SMILES notation:
[O-][N+](=O)c1ccc(F)c(F)c1
InChl:
InChI=1/C6H3F2NO2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H
Structural formula:
Chemical structure

Related substances

Categories Display