Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1,4-bis[2-(tert-butylperoxy)propan-2-yl]benzene

Inventory

EC number:
220-479-1
EC name:
Di-tert-butyl α,α,α',α'-tetramethyl-(p-phenylenedimethylene) diperoxide
CAS number:
2781-00-2
CAS number:
2781-00-2
Synonyms
Names:
Peroxide, 1,1'-[1,4-phenylenebis(1-methylethylidene)]bis[2-(1,1-dimethylethyl)
di-tert-Butyl α,α,α',α'-tetramethyl-(p-phenylenedimethylene) diperoxide
1,4-bis[1-(tert-butylperoxy)-1-methylethyl]benzene

Molecular and structural information

Molecular formula:
C20H34O4
Molecular weight:
ca. 338.482
SMILES notation:
CC(C)(C)OOC(C)(C)c1ccc(cc1)C(C)(C)OOC(C)(C)C
InChl:
InChI=1/C20H34O4/c1-17(2,3)21-23-19(7,8)15-11-13-16(14-12-15)20(9,10)24-22-18(4,5)6/h11-14H,1-10H3
Structural formula:
Chemical structure

Related substances