Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
calcium bis{4-[(E)-(5-carbamoyl-2-methoxyphenyl)diazenyl]-3-hydroxy-2-naphthoate}

Inventory

CAS number:
1204232-63-2
Synonyms
Names:
3-hydroxy-4-[(3-carbamoyl-6-methoxyphenyl)azo]-2-naphthalenecarboxylic acid calcium salt

Molecular and structural information

Molecular formula:
C38H28CaN6O10
Molecular weight:
852.59
SMILES notation:
[Ca+2].COc3ccc(cc3/N=N/c1c2ccccc2cc(C([O-])=O)c1O)C(N)=O.[O-]C(=O)c3cc1ccccc1c(/N=N/c2cc(ccc2OC)C(N)=O)c3O
Structural formula:
Chemical structure

Related substances

Categories Display