Registration Dossier

Diss Factsheets

IUPAC name:
(8R,9S,13S,14S)-3-benzyloxy)-13-methyl-6,7,8,9,11,12,13,14- octahydrospiro[cyclopenta[a]phenanthrene-17,2`[1,3]dioxolane]

Inventory

CAS number:
534572-67-3

Synonyms

Molecular and structural information

Molecular formula:
C27H30O3
Molecular weight:
402.525
SMILES notation:
CC12CCC3C(C1C=CC24OCCO4)CCC5=C3C=CC(=C5)OCC6=CC=CC=C6
Structural formula:
Chemical structure

Related substances