Registration Dossier

Diss Factsheets

IUPAC name:
(3E)-3-methyl-5-[(1R)-2,2,3-trimethylcyclopent-3-en-1-yl]pent-3-en-2-one

Inventory

CAS number:
208034-56-4

Synonyms

Molecular and structural information

Molecular formula:
C14H22O
Molecular weight:
206.32
SMILES notation:
CC1(C)C(C)=CC[C@@H]1C\C=C(/C)C(C)=O
InChl:
InChI=1S/C14H22O/c1-10(12(3)15)6-8-13-9-7-11(2)14(13,4)5/h6-7,13H,8-9H2,1-5H3/b10-6+/t13-/m0/s1
Structural formula:
Chemical structure

Related substances