Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
(2S)-5-methoxy-N-propyl-1,2,3,4-tetrahydronaphthalen-2-aminium chloride

Inventory

CAS number:
93601-86-6
Synonyms
Names:
(S)-1,2,3,4-Tetrahydro-5-methoxy-N-propyl-2-naphthalenamine hydrochloride

Molecular and structural information

Molecular formula:
C14H22ClNO
Molecular weight:
ca. 255.78
SMILES notation:
COC1=CC=CC2=C1CC[C@H](NCCC)C2.Cl
InChl:
1S/C14H21NO.ClH/c1-3-9-15-12-7-8-13-11(10-12)5-4-6-14(13)16-2;/h4-6,12,15H,3,7-10H2,1-2H3;1H/t12-;/m0./s1
Structural formula:
Chemical structure

Related substances