Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
Bis[bis(2-ethylhexyl)dithiocarbamato-S,S'](dipentyldithiocarbamato-S,S')antimony

Inventory

Synonyms
Names:
Identifier:
EC name
Bis[bis(2-ethylhexyl)dithiocarbamato-S,S'](dipentyldithiocarbamato-S,S')antimony

Molecular and structural information

Molecular formula:
C45H90N3S6Sb
Molecular weight:
987.37
SMILES notation:
CCCCCN(CCCCC)C(=S)S[Sb](SC(=S)N(CC(CC)CCCC)CC(CC)CCCC)SC(=S)N(CC(CC)CCCC)CC(CC)CCCC
InChl:
InChI=1S/2C17H35NS2.C11H23NS2.Sb/c2*1-5-9-11-15(7-3)13-18(17(19)20)14-16(8-4)12-10-6-2;1-3-5-7-9-12(11(13)14)10-8-6-4-2;/h2*15-16H,5-14H2,1-4H3,(H,19,20);3-10H2,1-2H3,(H,13,14);/q;;;+3/p-3
Structural formula:
Chemical structure

Related substances