dangerous-subs-eco-labels
dangerous-subs-eco-labels
Ecolabels - Restrictions for Hazardous Substances/Mixtures
This list contains a non-exhaustive inventory of substances based on the list of hazardous substances with harmonised classification and labelling (i.e. Table 3 of Annex VI to the CLP Regulation), and the Candidate List of substances of very high concern (SVHCs). Pursuant to Article 6(6) of the EU Ecolabel Regulation, the ecolabel must not be awarded to goods containing substances or mixtures classified according to the CLP as toxic; hazardous to the environment; and carcinogenic, mutagenic, or toxic for reproduction (CMRs). Nor are products allowed the ecolabel award when they contain SVHCs (per Article 57 of REACH). While the CLP's harmonised list contains many such substances, other ones not listed in Table 3 may also meet the criteria specified for classification under the CLP.
arsenic compounds, with the exception of those specified elsewhere in this Annex
ecnumber: - casnumber: -| Table 3 of Annex VI to CLP |
yes
|
Help
Group members
substance-members-text
Results list is empty
| Name | EC / List no. | CAS no. | Association |
|---|---|---|---|
| Arsenic sulfide | 215-117-4 | 1303-33-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid, (H3-As-O4), lead(4+) salt (4:3) | - | 53404-12-9 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), copper(2+) salt (1:1) | - | 13464-31-8 | diss.rml.association.type.EXPERT |
| Trisodium 2-(-hydrogen arsonatophenylazo)-1,8-dihydroxynaphthalene-3,6-disulphonate | 208-285-5 | 520-10-5 | diss.rml.association.type.EXPERT |
| Diiodo(phenyl)arsine | 228-965-5 | 6380-34-3 | diss.rml.association.type.EXPERT |
|
Lead, antimonial, dross
A scum formed on the surface of antimonial lead. Consists primarily of sodium arsenate and sodium antimonate with some lead oxide and free caustic soda.
|
273-795-7 | 69029-51-2 | diss.rml.association.type.EXPERT_ECHA |
| 4-cyclohexyl-2,6-dimethylpyrylium hexafluoroarsenate | 282-701-3 | 84304-16-5 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic chloride (AsCl2) | - | 41996-37-6 | diss.rml.association.type.EXPERT |
| Rammelsbergite (NiAs2) | - | 1303-22-6 | diss.rml.association.type.EXPERT |
| Diphenoxarsin-10-yl oxide | 200-377-3 | 58-36-6 | diss.rml.association.type.EXPERT |
| Diphenyldiarsenic acid | 224-845-1 | 4519-32-8 | diss.rml.association.type.EXPERT_ECHA |
| Tripotassium arsenate 3/2hydrate | - | 62702-52-7 | diss.rml.association.type.EXPERT |
| Iron diarsenide | 234-485-7 | 12006-21-2 | diss.rml.association.type.EXPERT_ECHA |
| Strontium arsenide (SrAs3) | - | 61462-16-6 | diss.rml.association.type.EXPERT |
| Arsenous acid, lead(2+) salt (1:1) | - | 100822-74-0 | diss.rml.association.type.EXPERT |
| Arsine | 232-066-3 | 7784-42-1 | diss.rml.association.type.EXPERT |
| Arsenous acid, gallium salt (1:1) | - | 24343-41-7 | diss.rml.association.type.EXPERT |
| Sodium hydrogen 4-aminophenylarsonate | 204-869-9 | 127-85-5 | diss.rml.association.type.EXPERT |
| Ytterbium arsenide | 234-483-6 | 12006-12-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic pentachloride | - | 22441-45-8 | diss.rml.association.type.EXPERT |
| Thallium triarsenide | 281-902-3 | 84057-85-2 | diss.rml.association.type.EXPERT_ECHA |
| Calcium arsenite | 258-147-3 | 52740-16-6 | diss.rml.association.type.EXPERT |
| Arsine, tris(2-chloroethenyl)- | - | 40334-70-1 | diss.rml.association.type.EXPERT |
| Arsenopyrite, cobaltoan | - | 12414-94-7 | diss.rml.association.type.EXPERT |
| Europium arsenide | 251-206-4 | 32775-46-5 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), calcium salt (4:5) | - | 89067-81-2 | diss.rml.association.type.EXPERT |
| 4-hydroxyphenylarsonic acid | 202-641-3 | 98-14-6 | diss.rml.association.type.EXPERT |
| Silicic acid (H4SiO4), zinc salt (1:2), arsenic and manganese-doped | 271-895-5 | 68611-46-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), cobalt(2+) salt | - | 29871-10-1 | diss.rml.association.type.EXPERT |
| Chlorotris(triphenylarsine)rhodium | 239-051-0 | 14973-92-3 | diss.rml.association.type.EXPERT |
| Arsine oxide, dichloro(2-chlorovinyl)- | - | 333-25-5 | diss.rml.association.type.EXPERT |
| Proustite (Ag3(AsS3)) | 239-179-7 | 15122-58-4 | diss.rml.association.type.EXPERT |
| Arsenic acid, tripotassium salt | - | 13464-36-3 | diss.rml.association.type.EXPERT |
| Arsenenous acid, rubidium salt | - | 85906-44-1 | diss.rml.association.type.EXPERT |
| Arsenic selenide | - | 12626-31-2 | diss.rml.association.type.EXPERT |
| 2,2'-[ethylenebis(oxy)]bis[1,3,2-dioxarsolane] | 238-911-2 | 14849-23-1 | diss.rml.association.type.EXPERT |
| Silicic acid (H4SiO4), tetraethyl ester, polymer with arsenic oxide (As2O3) | - | 68957-75-5 | diss.rml.association.type.EXPERT |
| Cobalt arsenide | 265-784-0 | 65453-05-6 | diss.rml.association.type.EXPERT_ECHA |
| Carbarsone | 204-484-6 | 121-59-5 | diss.rml.association.type.EXPERT |
| 4-(4-dimethylaminophenylazo)phenylarsonic acid | 210-750-2 | 622-68-4 | diss.rml.association.type.EXPERT |
| Arsenic chloride (AsCl) | - | 17522-78-0 | diss.rml.association.type.EXPERT |
| Potassium dihydrogenarsenate | 232-065-8 | 7784-41-0 | diss.rml.association.type.EXPERT_ECHA |
| Arsanilic acid | 202-674-3 | 98-50-0 | diss.rml.association.type.EXPERT |
| Diarsenic pentaoxide | 215-116-9 | 1303-28-2 | diss.rml.association.type.EXPERT_ECHA |
| Platinum arsenide (PtAs2) | - | 12044-52-9 | diss.rml.association.type.EXPERT |
| Arsenous acid, antimony(3+) salt (1:1) | - | 12523-20-5 | diss.rml.association.type.EXPERT |
| Niobium arsenide | 235-503-6 | 12255-08-2 | diss.rml.association.type.EXPERT_ECHA |
| Nickel arsenide | - | 12795-30-1 | diss.rml.association.type.EXPERT |
| o-phenylenediarsonic acid | 217-154-1 | 1758-48-1 | diss.rml.association.type.EXPERT |
| Arsenic acid, calcium salt | 233-287-8 | 10103-62-5 | diss.rml.association.type.EXPERT_ECHA |
| Roxarsone | 204-453-7 | 121-19-7 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, cadmium salt | - | 84953-43-5 | diss.rml.association.type.EXPERT |
| Arsenic trichloride | 232-059-5 | 7784-34-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid | - | 13768-07-5 | diss.rml.association.type.EXPERT |
| Lead hydrogen arsenate | 232-064-2 | 7784-40-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic chloride | - | 37226-49-6 | diss.rml.association.type.EXPERT |
| Tricobalt diarsenate | 246-429-9 | 24719-19-5 | diss.rml.association.type.EXPERT_ECHA |
| Disodium 3,6-bis[[2-[(dihydroxyarsino)oxy]phenyl]azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 282-453-6 | 84215-47-4 | diss.rml.association.type.EXPERT |
| Arsenenic acid | - | 10102-53-1 | diss.rml.association.type.EXPERT |
| Difetarsone | 222-866-0 | 3639-19-8 | diss.rml.association.type.EXPERT |
| Neoarsphenamine | 207-273-7 | 457-60-3 | diss.rml.association.type.EXPERT_ECHA |
| Disodium 3-[(o-arsonophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 222-600-3 | 3547-38-4 | diss.rml.association.type.EXPERT |
| Methyldiphenylarsine | 213-414-3 | 945-48-2 | diss.rml.association.type.EXPERT |
| Tricopper arsenide | 234-472-6 | 12005-75-3 | diss.rml.association.type.EXPERT_ECHA |
| Sodium metaarsenate | 239-171-3 | 15120-17-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsenous acid, zinc salt (2:3) | - | 28837-97-0 | diss.rml.association.type.EXPERT |
| Methyloxoarsine | 209-799-2 | 593-58-8 | diss.rml.association.type.EXPERT |
| (2-Chloroethenyl)arsonous dichloride | - | 541-25-3 | diss.rml.association.type.EXPERT |
| Trifluoroarsine | 232-060-0 | 7784-35-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsonic acid, [4-[[4-(dimethylamino)phenyl]azo]phenyl]-, monohydrochloride | 620-678-7 | 73688-85-4 | diss.rml.association.type.EXPERT |
| Sulfarsphenamine | 210-564-1 | 618-82-6 | diss.rml.association.type.EXPERT_ECHA |
| o-phenylenebis(dimethylarsine) | 236-227-9 | 13246-32-7 | diss.rml.association.type.EXPERT |
| Manganese hydrogenarsenate | 232-063-7 | 7784-38-5 | diss.rml.association.type.EXPERT_ECHA |
| Boron arsenate | - | 13510-31-1 | diss.rml.association.type.EXPERT |
| Arsenenous acid, ammonium zinc salt | - | 94854-80-5 | diss.rml.association.type.EXPERT |
| Arsenenous acid, neodymium(3+) salt | - | 76871-63-1 | diss.rml.association.type.EXPERT |
| Copper diarsenite | 240-574-1 | 16509-22-1 | diss.rml.association.type.EXPERT_ECHA |
| Tritylium hexafluoroarsenate | 207-111-5 | 437-15-0 | diss.rml.association.type.EXPERT_ECHA |
| Arsonic acid, lead(2+) salt (1:1) | - | 109882-46-4 | diss.rml.association.type.EXPERT |
| Tristrontium diarsenate | 236-684-4 | 13464-68-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic(II) sulfide | - | 12044-79-0 | diss.rml.association.type.EXPERT |
|
Flue dust, arsenic-contg.
Formed when arsenic and metal oxide particles are driven off during the roasting and converting of copper concentrates and matte in the production of anode copper.
|
232-434-3 | 8028-73-7 | diss.rml.association.type.EXPERT_ECHA |
| iron;iron(3+);methyl-dioxido-oxo-$l^{5}-arsane | - | 6585-53-1 | diss.rml.association.type.EXPERT |
| Lutetium arsenide | 234-477-3 | 12005-94-6 | diss.rml.association.type.EXPERT_ECHA |
| Calcium arsenate fluoride | - | 17068-86-9 | diss.rml.association.type.EXPERT |
| Arsenic oxide | - | 12777-38-7 | diss.rml.association.type.EXPERT |
| Arsenic acid, copper(2+) salt | 249-916-4 | 29871-13-4 | diss.rml.association.type.EXPERT_ECHA |
| Tribarium diarsenide | 235-508-3 | 12255-50-4 | diss.rml.association.type.EXPERT_ECHA |
| Triphenylsulphonium hexafluoroarsenate(1-) | 261-009-5 | 57900-42-2 | diss.rml.association.type.EXPERT_ECHA |
| Disodium 3-[[2-[(dihydroxyarsino)oxy]phenyl]azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 282-454-1 | 84215-48-5 | diss.rml.association.type.EXPERT |
| Germanium arsenide | 235-547-6 | 12271-72-6 | diss.rml.association.type.EXPERT_ECHA |
| Magnesium arsenate, decahydrate | - | 117746-50-6 | diss.rml.association.type.EXPERT |
| Arsenenous acid, ammonium copper salt | - | 94854-78-1 | diss.rml.association.type.EXPERT |
| Arsenenous acid, antimony(3+) salt | - | 83877-96-7 | diss.rml.association.type.EXPERT |
| Triethyl arsenate | 427-700-2 | 15606-95-8 | diss.rml.association.type.EXPERT |
| Methylenebis(diphenylarsine) | 244-639-5 | 21892-63-7 | diss.rml.association.type.EXPERT |
| Arsenic acid, calcium salt (1:2) | - | 13464-39-6 | diss.rml.association.type.EXPERT |
| Arsenic acid, sodium salt | 231-547-5 | 7631-89-2 | diss.rml.association.type.EXPERT_ECHA |
| ARSENIC ACID (H3ASO4), HEMIHYDRATE | - | 7774-41-6 | diss.rml.association.type.EXPERT |
| Arsorane, pentahydroxy-, copper(2+) salt (1:2) | - | - | diss.rml.association.type.EXPERT |
| Calcium bis(dimethylarsinate) | 227-311-6 | 5785-43-3 | diss.rml.association.type.EXPERT |
| Arsine, dichloromethyl- | 695-189-5 | 593-89-5 | diss.rml.association.type.EXPERT |
| Iron arsenide | 234-947-8 | 12044-16-5 | diss.rml.association.type.EXPERT_ECHA |
| Diphenylarsine | 212-589-3 | 829-83-4 | diss.rml.association.type.EXPERT |
| Strychnine arsenate | 233-970-0 | 10476-82-1 | diss.rml.association.type.EXPERT_ECHA |
| Pentahydroxyarsorane | 232-096-7 | 7786-36-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic tetrachloride fluoride | - | 87198-15-0 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), lead(2+) salt (2:3), tetrahydrate | - | 120119-64-4 | diss.rml.association.type.EXPERT |
| Trisodium 3-[(o-arsonatophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 266-069-6 | 66019-20-3 | diss.rml.association.type.EXPERT |
| Potassium hexafluoroarsenate | 241-102-7 | 17029-22-0 | diss.rml.association.type.EXPERT_ECHA |
| Arsonic acid, methyl-, calcium salt (1:1) | - | 6423-72-9 | diss.rml.association.type.EXPERT |
| Arsonate | - | 36465-76-6 | diss.rml.association.type.EXPERT |
| 4-[(2-arsonophenyl)azo]-3-hydroxynaphthalene-2,7-disulphonic acid | 205-058-2 | 132-33-2 | diss.rml.association.type.EXPERT |
| trisodium;trioxido(oxo)-$l^{5}-arsane;dodecahydrate | - | 13510-46-8 | diss.rml.association.type.EXPERT |
| Arsenenous acid, cesium salt | - | 82005-78-5 | diss.rml.association.type.EXPERT |
|
Flue dust, lead-refining
By-product of refining lead ores obtained from baghouse and electro-static precipitator and as slurry from scrubbers.
|
273-809-1 | 69029-67-0 | diss.rml.association.type.EXPERT_ECHA |
| Arsenous acid, iron(3+) salt (1:1) | - | 60168-33-4 | diss.rml.association.type.EXPERT |
| Tricalcium diarsenide | 235-509-9 | 12255-53-7 | diss.rml.association.type.EXPERT_ECHA |
| Iron arsenate | 233-274-7 | 10102-49-5 | diss.rml.association.type.EXPERT_ECHA |
| Samarium arsenide | 235-506-2 | 12255-39-9 | diss.rml.association.type.EXPERT_ECHA |
| Tris[(8α)-6'-methoxycinchonan-9(R)-ol] arsenite | 303-002-2 | 94138-87-1 | diss.rml.association.type.EXPERT_ECHA |
| Thiobis[methylarsine], anhydrosulphide | 236-436-5 | 13367-92-5 | diss.rml.association.type.EXPERT |
|
Slimes and Sludges, copper refining
A complex combination resulting from copper processing---other than electrolytic.
|
266-977-2 | 67712-00-9 | diss.rml.association.type.EXPERT_ECHA |
| Ammonium magnesium arsenate | - | 14644-70-3 | diss.rml.association.type.EXPERT |
| Arsenenous acid, manganese(2+) salt | - | 85561-29-1 | diss.rml.association.type.EXPERT |
| Tetraphenylarsonium Chloride Hydrochloride Hydrate | 621-302-4 | 123334-18-9 | diss.rml.association.type.EXPERT |
| arsenic acid (H3AsO4), calcium salt(2:3), dihydrate | - | 30621-31-9 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), lead(2+) salt (4:5) | - | 89054-03-5 | diss.rml.association.type.EXPERT |
| Manganese arsenide | 234-478-9 | 12005-95-7 | diss.rml.association.type.EXPERT_ECHA |
| Indium arsenide | 215-115-3 | 1303-11-3 | diss.rml.association.type.EXPERT_ECHA |
| Ethylenebis(diphenylarsine) | 224-629-7 | 4431-24-7 | diss.rml.association.type.EXPERT |
| Praseodymium arsenide | 234-953-0 | 12044-28-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsthinol | 204-361-7 | 119-96-0 | diss.rml.association.type.EXPERT |
| (Carboxymethyl)trimethylarsonium hydroxide inner salt | 634-697-3 | 64436-13-1 | diss.rml.association.type.EXPERT |
| Difetarsone disodium | 208-209-0 | 515-76-4 | diss.rml.association.type.EXPERT |
| Arsenenous acid, cadmium neodymium(3+) salt (5:1:1) | - | 76871-66-4 | diss.rml.association.type.EXPERT |
| Zinc diarsenide | 234-956-7 | 12044-55-2 | diss.rml.association.type.EXPERT_ECHA |
| Allylarsonic acid | 209-678-4 | 590-34-1 | diss.rml.association.type.EXPERT |
| Aluminium arsenide | 245-255-0 | 22831-42-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, lutetium(3+) salt | - | 76871-65-3 | diss.rml.association.type.EXPERT |
| Tin arsenide (SnAs) | - | 12044-32-5 | diss.rml.association.type.EXPERT |
| Triphenylarsine | 210-032-9 | 603-32-7 | diss.rml.association.type.EXPERT |
| Calcium arsenate | 231-904-5 | 7778-44-1 | diss.rml.association.type.EXPERT_ECHA |
| Zinc arsenenate oxide (Zn5(AsO3)4O3), tetrahydrate | - | 1303-39-5 | diss.rml.association.type.EXPERT |
| Zinc arsenate, octahydrate | - | 13510-72-0 | diss.rml.association.type.EXPERT |
| Sodium cacodylate trihydrate | 682-793-9 | 6131-99-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), magnesium salt, manganese-doped | 310-019-9 | 102110-21-4 | diss.rml.association.type.EXPERT_ECHA |
| Manganese arsenide (Mn2As) | - | 12005-96-8 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), lead(4+) salt (3:2) | - | 10102-48-4 | diss.rml.association.type.EXPERT |
| Glycobiarsol | 204-143-1 | 116-49-4 | diss.rml.association.type.EXPERT |
| Arsenic disulfide | 627-949-9 | 1303-32-8 | diss.rml.association.type.EXPERT |
| Sodium hydrogen [4-[(hydroxyacetyl)amino]phenyl]arsonate | 205-415-2 | 140-45-4 | diss.rml.association.type.EXPERT |
| Arsenic triiodide | 232-068-4 | 7784-45-4 | diss.rml.association.type.EXPERT_ECHA |
| Melarsonyl potassium | 236-405-6 | 13355-00-5 | diss.rml.association.type.EXPERT |
| Tetraphenylarsonium chloride | 208-070-6 | 507-28-8 | diss.rml.association.type.EXPERT |
| Boron arsenide (B6As) | - | 12005-70-8 | diss.rml.association.type.EXPERT |
| Trimagnesium diarsenide | 234-954-6 | 12044-49-4 | diss.rml.association.type.EXPERT_ECHA |
| N-(p-arsenosophenyl)-1,3,5-triazine-2,4,6-triamine | 244-612-8 | 21840-08-4 | diss.rml.association.type.EXPERT_ECHA |
| Gallium arsenide phosphide | - | 106097-61-4 | diss.rml.association.type.EXPERT |
| Tribarium diarsenate | 236-762-8 | 13477-04-8 | diss.rml.association.type.EXPERT_ECHA |
| Trimanganese arsenide | 262-667-6 | 61219-26-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsenous acid, copper(2+) salt, hydrate, (2:3:3) | - | 73156-86-2 | diss.rml.association.type.EXPERT |
| Triethylarsine | 210-526-4 | 617-75-4 | diss.rml.association.type.EXPERT |
| Arsenous acid, tripotassium salt | - | 36267-15-9 | diss.rml.association.type.EXPERT |
| Thulium arsenide | 234-482-0 | 12006-10-9 | diss.rml.association.type.EXPERT_ECHA |
| Sodium hydrogen (3-acetamido-4-hydroxyphenyl)arsonate | 227-573-1 | 5892-48-8 | diss.rml.association.type.EXPERT |
| Sodium hexafluoroarsenate(V) | 624-772-9 | 12005-86-6 | diss.rml.association.type.EXPERT_ECHA |
| Gadolinium arsenide | 234-475-2 | 12005-89-9 | diss.rml.association.type.EXPERT_ECHA |
| 4-acetamidophenylarsonic acid | 210-541-6 | 618-22-4 | diss.rml.association.type.EXPERT |
| Dibismuth tris(methylarsonate) | 286-401-3 | 85237-42-9 | diss.rml.association.type.EXPERT |
| Disodium hydrogen 2-[[7-[(2-arsonophenyl)azo]-1,8-dihydroxy-3,6-disulphonato-2-naphthyl]azo]benzoate | 238-715-7 | 14674-83-0 | diss.rml.association.type.EXPERT |
| Sodium hydrogen [4-(acetamido)phenyl]arsonate | 209-558-1 | 585-54-6 | diss.rml.association.type.EXPERT |
| 10-chloro-10H-phenoxarsine | 220-684-6 | 2865-70-5 | diss.rml.association.type.EXPERT |
| Arsenenous acid, cobalt(2+) salt | - | 85561-28-0 | diss.rml.association.type.EXPERT |
| Trilithium arsenide | 234-950-4 | 12044-22-3 | diss.rml.association.type.EXPERT_ECHA |
| Trilithium arsenate | 236-773-8 | 13478-14-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), copper(2+) salt (1:1), sesquihydrate | - | 88442-64-2 | diss.rml.association.type.EXPERT |
| Arsenous acid, tricopper(1+) salt | - | 33382-64-8 | diss.rml.association.type.EXPERT |
| 3-amino-4-hydroxyphenylarsonic acid | 218-494-3 | 2163-77-1 | diss.rml.association.type.EXPERT |
| Trilead diarsenate | 222-979-5 | 3687-31-8 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic sulfide (AsS2) | - | 56320-22-0 | diss.rml.association.type.EXPERT |
| Tristrontium diarsenide | 254-407-5 | 39297-24-0 | diss.rml.association.type.EXPERT_ECHA |
| Antimony arsenic oxide | 264-904-9 | 64475-90-7 | diss.rml.association.type.EXPERT_ECHA |
| Diarsenic trioxide | 215-481-4 | 1327-53-3 | diss.rml.association.type.EXPERT_ECHA |
| Erbium arsenide | 235-501-5 | 12254-88-5 | diss.rml.association.type.EXPERT_ECHA |
| Tetramethyldiarsine | 207-440-4 | 471-35-2 | diss.rml.association.type.EXPERT |
| Trizinc diarsenide | 234-486-2 | 12006-40-5 | diss.rml.association.type.EXPERT_ECHA |
| Terbium arsenide | 234-479-4 | 12006-08-5 | diss.rml.association.type.EXPERT_ECHA |
| Pentafluoroarsorane | 232-061-6 | 7784-36-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic trichloride | - | 60646-36-8 | diss.rml.association.type.EXPERT |
| Acetarsol--diethylamine (1:1) | 208-597-1 | 534-33-8 | diss.rml.association.type.EXPERT |
| Potassium arsenite | 236-680-2 | 13464-35-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, silver(1+) salt | - | 69507-43-3 | diss.rml.association.type.EXPERT |
| Strontium arsenite (Sr(As2O4)) | - | 91724-16-2 | diss.rml.association.type.EXPERT |
| Tris(pentane-2,4-dionato-O,O')silicon hexafluoroarsenate | 266-621-6 | 67251-38-1 | diss.rml.association.type.EXPERT_ECHA |
| Ferric arsenite, basic | - | 63989-69-5 | diss.rml.association.type.EXPERT |
| Arsenic tribromide | 232-057-4 | 7784-33-0 | diss.rml.association.type.EXPERT_ECHA |
| Sodium dimethylarsinate | 204-708-2 | 124-65-2 | diss.rml.association.type.EXPERT_ECHA |
| 4-(4-aminophenylazo)phenylarsonic acid | 230-176-6 | 6966-64-9 | diss.rml.association.type.EXPERT |
| Arsenic acid, copper salt | 233-286-2 | 10103-61-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic sulfide (As2S4) | - | - | diss.rml.association.type.EXPERT |
| Ammonium dihydrogenarsenate | 236-667-1 | 13462-93-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), calcium salt (7:10) | - | 85949-61-7 | diss.rml.association.type.EXPERT |
| Lead arsenite | 233-083-9 | 10031-13-7 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), copper(2+) salt (4:5) | - | 89054-01-3 | diss.rml.association.type.EXPERT |
| Sodium 4-(glycolloylamino)phenylarsonate | 231-680-9 | 7681-83-6 | diss.rml.association.type.EXPERT |
| Melarsoprol | 207-793-4 | 494-79-1 | diss.rml.association.type.EXPERT |
| Arsenic | 231-148-6 | 7440-38-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic tetrasulfide | - | 56729-51-2 | diss.rml.association.type.EXPERT |
| 3-methyl-4-(pyrrolidin-1-yl)benzenediazonium hexafluoroarsenate | 248-532-4 | 27569-09-1 | diss.rml.association.type.EXPERT_ECHA |
| 2-nitrophenylarsonic acid | 226-485-0 | 5410-29-7 | diss.rml.association.type.EXPERT |
| Disodium 3,6-bis[(o-arsonophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 263-516-7 | 62337-00-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenous acid, titanium salt | - | 92278-94-9 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), magnesium salt (2:3) | - | 21480-65-9 | diss.rml.association.type.EXPERT |
| Propylarsonic acid | 203-482-2 | 107-34-6 | diss.rml.association.type.EXPERT |
| Oxophenarsine hydrochloride | 208-682-3 | 538-03-4 | diss.rml.association.type.EXPERT_ECHA |
| Nickel arsenide | 248-169-1 | 27016-75-7 | diss.rml.association.type.EXPERT_ECHA |
| Diphenyliodonium hexafluoroarsenate | 263-638-0 | 62613-15-4 | diss.rml.association.type.EXPERT_ECHA |
| Nitarsone | 202-695-8 | 98-72-6 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), ammonium salt (2:1) | - | 127795-79-3 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), lead(4+) salt (2:1), monohydrate | - | 33940-95-3 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), copper(2+) salt (4:1) | - | 102525-64-4 | diss.rml.association.type.EXPERT |
| Yttrium arsenide | 235-507-8 | 12255-48-0 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), monopotassium salt, 1/5hydrate | - | 164170-84-7 | diss.rml.association.type.EXPERT |
| Copper arsonate | 233-644-8 | 10290-12-7 | diss.rml.association.type.EXPERT |
| Tin arsenide (Sn4As3) | - | 12397-66-9 | diss.rml.association.type.EXPERT |
| Calcium arsenate (CaHAsO4) (6CI,7CI) | 672-782-7 | 15195-00-3 | diss.rml.association.type.EXPERT |
| Ammonium copper arsenate | 251-151-6 | 32680-29-8 | diss.rml.association.type.EXPERT_ECHA |
| Tri-p-tolylarsine | 220-776-6 | 2896-10-8 | diss.rml.association.type.EXPERT |
| Arsenenous acid, praseodymium(3+) salt | - | 86859-92-9 | diss.rml.association.type.EXPERT |
| Arsenic sulfide (As2S5) | 625-728-1 | 1303-34-0 | diss.rml.association.type.EXPERT |
| [4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonic acid | 227-365-0 | 5806-89-3 | diss.rml.association.type.EXPERT |
| Dimethylarsinic acid | 200-883-4 | 75-60-5 | diss.rml.association.type.EXPERT_ECHA |
| Tripotassium arsenide | 234-949-9 | 12044-21-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenazo III sodium | 630-782-4 | 138608-19-2 | diss.rml.association.type.EXPERT |
| Dichloro(ethyl)arsine | 209-919-3 | 598-14-1 | diss.rml.association.type.EXPERT |
| Disodium methylarsonate | 205-620-7 | 144-21-8 | diss.rml.association.type.EXPERT |
| (4-((2-Amino-2-oxoethyl)amino)phenyl)arsonic acid | - | 618-25-7 | diss.rml.association.type.EXPERT |
| Arsonic acid, methyl-, compd. with 1-octanamine (1:1) | - | 6379-37-9 | diss.rml.association.type.EXPERT |
| Iododimethylarsine | 211-630-2 | 676-75-5 | diss.rml.association.type.EXPERT |
| Arsenenous acid, mercury(2+) salt | - | 82980-40-3 | diss.rml.association.type.EXPERT |
| Disodium hydrogenarsenate | 231-902-4 | 7778-43-0 | diss.rml.association.type.EXPERT_ECHA |
| Strychnine dimethylarsinate | 233-973-7 | 10476-87-6 | diss.rml.association.type.EXPERT |
| Bis[(2-diphenylarsinoethyl)phenyl]phosphine | 245-756-4 | 23582-05-0 | diss.rml.association.type.EXPERT |
| Trisodium 4-[(o-arsonophenyl)azo]-3-oxidonaphthalene-2,7-disulphonate | 258-693-2 | 53669-45-7 | diss.rml.association.type.EXPERT |
| Disodium p-tolylarsonate | 304-956-2 | 94313-58-3 | diss.rml.association.type.EXPERT |
| Methyl 17α-hydroxyyohimban-16α-carboxylate, methylarsonate (1:1) | 279-628-4 | 80925-03-7 | diss.rml.association.type.EXPERT |
| Bromo(hydroxytetraphenylarsoranato)magnesium | 264-254-6 | 63468-73-5 | diss.rml.association.type.EXPERT |
| Hydrogen hexafluoroarsenate | 241-128-9 | 17068-85-8 | diss.rml.association.type.EXPERT_ECHA |
| Trinickel bis(arsenate) | 236-771-7 | 13477-70-8 | diss.rml.association.type.EXPERT_ECHA |
| Diarsenic acid, sodium salt | - | 13464-42-1 | diss.rml.association.type.EXPERT |
| Arsenenous acid, lithium salt | - | 72845-34-2 | diss.rml.association.type.EXPERT |
| 10-[(dimethylthiocarbamoyl)thio]-5,10-dihydrophenarsazine | 225-368-1 | 4808-24-6 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), monosodium salt | - | 10103-60-3 | diss.rml.association.type.EXPERT |
| Arsenenous acid, calcium salt (2:1) | - | 15194-98-6 | diss.rml.association.type.EXPERT |
| Trimethylarsine | 209-815-8 | 593-88-4 | diss.rml.association.type.EXPERT |
| Calcium bis(methylarsonate) | 227-598-8 | 5902-95-4 | diss.rml.association.type.EXPERT |
| Manganese arsenate | - | 27526-45-0 | diss.rml.association.type.EXPERT |
| Zinc arsenide | - | 56450-43-2 | diss.rml.association.type.EXPERT |
| Tetraphenylarsonium chloride, compound with hydrochloric acid (1:1) | 277-208-5 | 73003-83-5 | diss.rml.association.type.EXPERT |
| Triantimony arsenide | 235-505-7 | 12255-36-6 | diss.rml.association.type.EXPERT_ECHA |
| Methyltriphenylarsonium iodide | 216-108-8 | 1499-33-8 | diss.rml.association.type.EXPERT |
| Bis(pentane-2,4-dionato-O,O')boron(1+) hexafluoroarsenate(1-) | 272-591-5 | 68892-01-3 | diss.rml.association.type.EXPERT_ECHA |
| Benzenesulfonic acid, 4-arsenoso-, sodium salt | - | 71130-50-2 | diss.rml.association.type.EXPERT |
| Disodium arsonoacetate | 204-806-5 | 126-82-9 | diss.rml.association.type.EXPERT |
| Diarsenic triselenide | 215-119-5 | 1303-36-2 | diss.rml.association.type.EXPERT_ECHA |
| p-tolylarsonic acid | 223-588-2 | 3969-54-8 | diss.rml.association.type.EXPERT |
| 4-Aminophenylarsenoxide | - | 1122-90-3 | diss.rml.association.type.EXPERT |
| Leucomycin V, 9-O-[5-(dimethylamino)tetrahydro-6-methyl-2H-pyran-2-yl]-, [9(5S,6R)]-, [1,2-ethanediylbis(imino-4,1-phenylene)]bis[arsonate] (1:1) (salt) | 299-051-1 | 93841-79-3 | diss.rml.association.type.EXPERT |
| Boron arsenide (BAs) | - | 12005-69-5 | diss.rml.association.type.EXPERT |
| Antimony arsenate | 249-347-1 | 28980-47-4 | diss.rml.association.type.EXPERT_ECHA |
| arsenic acid, calcium salt | - | 89054-07-9 | diss.rml.association.type.EXPERT |
| Iron tris(dimethylarsinate) | 227-759-2 | 5968-84-3 | diss.rml.association.type.EXPERT |
| [2-(diphenylarsino)ethyl]diphenylphosphine | 245-758-5 | 23582-06-1 | diss.rml.association.type.EXPERT |
| Sodium hydrogen allylarsonate | 304-710-4 | 94278-22-5 | diss.rml.association.type.EXPERT |
| Arsenous acid | - | 13464-58-9 | diss.rml.association.type.EXPERT |
| Arsenious acid (HAsO2), strontium salt | - | 15195-06-9 | diss.rml.association.type.EXPERT |
| Diiron arsenide | 234-474-7 | 12005-88-8 | diss.rml.association.type.EXPERT_ECHA |
| Silicic acid (H4SiO4), magnesium manganese(2+) zinc salt, arsenic and lead-doped | - | 68784-76-9 | diss.rml.association.type.EXPERT |
| Tricadmium diarsenide | 234-484-1 | 12006-15-4 | diss.rml.association.type.EXPERT |
| Gallium arsenide | 215-114-8 | 1303-00-0 | diss.rml.association.type.EXPERT_ECHA |
| (4-aminophenyl)arsonic acid, compound with piperazine (1:1) | 303-952-8 | 94232-26-5 | diss.rml.association.type.EXPERT |
| Silver hexafluoroarsenate | 624-776-0 | 12005-82-2 | diss.rml.association.type.EXPERT |
|
Lead alloy, base, dross
A scum formed on the surface of molten lead-base alloys. Includes those cases in which aluminum is used to remove arsenic, nickel and antimony.
|
273-700-9 | 69011-59-2 | diss.rml.association.type.EXPERT_ECHA |
| Antimony oxide (Sb2O3), mixed with arsenic oxide (As2O3) | 273-156-2 | 68951-38-2 | diss.rml.association.type.EXPERT_ECHA |
| Dysprosium arsenide | 234-473-1 | 12005-81-1 | diss.rml.association.type.EXPERT_ECHA |
| [No public or meaningful name is available] | - | 16973-45-8 | diss.rml.association.type.EXPERT |
| Sodium p-[[4-[3-(2-arsono-4-nitrophenyl)triazen-1-yl]phenyl]azo]benzenesulphonate | 217-197-6 | 1772-02-7 | diss.rml.association.type.EXPERT |
| Gallium arsenic phosphide | - | 60953-19-7 | diss.rml.association.type.EXPERT |
| Tetraarsenic tetrasulfide | - | 12279-90-2 | diss.rml.association.type.EXPERT |
| Aluminium gallium arsenide | 680-872-2 | 37382-15-3 | diss.rml.association.type.EXPERT |
| 10-chloro-5,10-dihydrophenarsazine | 209-433-1 | 578-94-9 | diss.rml.association.type.EXPERT |
| Trisodium arsenide | 234-952-5 | 12044-25-6 | diss.rml.association.type.EXPERT_ECHA |
| Sodium methylarsonate | 218-495-9 | 2163-80-6 | diss.rml.association.type.EXPERT |
| Trisodium arsenite | 236-681-8 | 13464-37-4 | diss.rml.association.type.EXPERT_ECHA |
| Trisilver arsenide | 235-652-7 | 12417-99-1 | diss.rml.association.type.EXPERT_ECHA |
| ARSENIC(V) OXIDE HYDRATE | 629-626-8 | 12044-50-7 | diss.rml.association.type.EXPERT |
| Nickel diarsenide | 235-103-1 | 12068-61-0 | diss.rml.association.type.EXPERT_ECHA |
| Tryparsamide | 209-070-9 | 554-72-3 | diss.rml.association.type.EXPERT |
| 2,6-dimethyl-4-phenylpyrylium hexafluoroarsenate | 282-700-8 | 84304-15-4 | diss.rml.association.type.EXPERT_ECHA |
| Sodium oxidoarsonous acid | - | 60189-99-3 | diss.rml.association.type.EXPERT |
| Arsenenous acid, nickel(2+) salt | - | 33992-49-3 | diss.rml.association.type.EXPERT |
| Benzenesulfonic acid, 4-arsenoso- | - | 71130-51-3 | diss.rml.association.type.EXPERT |
| 2,7-(bis(2-arsonophenylazo))-1,8-dihydroxynaphthalene-3,6-disulphonic acid | 216-788-6 | 1668-00-4 | diss.rml.association.type.EXPERT |
| Iron bis(arsenate) | 233-275-2 | 10102-50-8 | diss.rml.association.type.EXPERT_ECHA |
| Tris[(8α,9R)-6'-methoxycinchonan-9-ol] bis(arsenate) | 208-971-4 | 549-59-7 | diss.rml.association.type.EXPERT_ECHA |
| Triammonium arsenate | 246-428-3 | 24719-13-9 | diss.rml.association.type.EXPERT_ECHA |
| Tricalcium diarsenite | 248-266-9 | 27152-57-4 | diss.rml.association.type.EXPERT_ECHA |
| Trisilver arsenite | 232-048-5 | 7784-08-9 | diss.rml.association.type.EXPERT_ECHA |
| 2-aminophenylarsonic acid | 218-064-5 | 2045-00-3 | diss.rml.association.type.EXPERT |
| Phenylarsine oxide | 211-275-3 | 637-03-6 | diss.rml.association.type.EXPERT_ECHA |
| Sodium arsenate dibasic heptahydrate | 677-900-0 | 10048-95-0 | diss.rml.association.type.EXPERT_ECHA |
| Tetraphenylarsonium (hydrogen dichloride) | 244-144-4 | 21006-73-5 | diss.rml.association.type.EXPERT |
| Copper acetoarsenite | 601-658-7 | 12002-03-8 | diss.rml.association.type.EXPERT |
| Arsenic sulfide | 235-720-6 | 12612-21-4 | diss.rml.association.type.EXPERT_ECHA |
| Methyl 1,2,5,6-tetrahydro-1-methylnicotinate, mono[(3-acetamido-4-hydroxyphenyl)arsonate] | 212-983-5 | 900-77-6 | diss.rml.association.type.EXPERT |
| 4-(ethylamino)-2-methylbenzenediazonium hexafluoroarsenate | 264-026-6 | 63217-32-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic bromide | 265-296-8 | 64973-06-4 | diss.rml.association.type.EXPERT_ECHA |
| Strychnidin-10-one, arsenite (1:1) | 309-388-9 | 100258-44-4 | diss.rml.association.type.EXPERT_ECHA |
| Lanthanum arsenide | 235-502-0 | 12255-04-8 | diss.rml.association.type.EXPERT_ECHA |
| 3-formamido-4-hydroxyphenylarsonic acid | 262-085-2 | 60154-16-7 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), copper(2+) salt (2:3) | - | - | diss.rml.association.type.EXPERT |
| Diammonium hydrogenarsenate | 232-067-9 | 7784-44-3 | diss.rml.association.type.EXPERT_ECHA |
| 4-chlorophenylarsonic acid | 226-622-4 | 5440-04-0 | diss.rml.association.type.EXPERT |
| (diphenylarsino)dimethylgallium | 302-587-1 | 94113-53-8 | diss.rml.association.type.EXPERT |
| Tetraarsenic trisulfide | - | 12512-13-9 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), bismuth salt (1:1) | - | 13702-38-0 | diss.rml.association.type.EXPERT |
| Digallium arsenide phosphide | 234-948-3 | 12044-20-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, cerium(3+) salt | - | 86859-93-0 | diss.rml.association.type.EXPERT |
| Iron arsenide | - | 39310-41-3 | diss.rml.association.type.EXPERT |
| Arsonic acid, tin salt | - | 93080-00-3 | diss.rml.association.type.EXPERT |
| Strychnidin-10-one, compd. with methylarsonate (1:1) | 279-614-8 | 80879-64-7 | diss.rml.association.type.EXPERT |
| Potassium arsonate | 233-337-9 | 10124-50-2 | diss.rml.association.type.EXPERT |
| Trisodium arsenate | 236-682-3 | 13464-38-5 | diss.rml.association.type.EXPERT_ECHA |
| Acetarsol | 202-582-3 | 97-44-9 | diss.rml.association.type.EXPERT |
| 2-[[7-[(2-arsonophenyl)azo]-1,8-dihydroxy-3,6-disulpho-2-naphthyl]azo]benzoic acid | 223-216-9 | 3772-44-9 | diss.rml.association.type.EXPERT |
| Neodymium arsenide | 235-504-1 | 12255-09-3 | diss.rml.association.type.EXPERT_ECHA |
| Methylarsonic acid | 204-705-6 | 124-58-3 | diss.rml.association.type.EXPERT |
| Arsonic acid, disodium salt | - | 13466-06-3 | diss.rml.association.type.EXPERT |
|
Slimes and Sludges, copper-lead ore roasting off gas scrubbing, arsenic-contg.
The product obtained by the purification of copper-lead ore concentrate roasting offgas. Composed primarily of arsenic oxide (As2O3).
|
310-063-9 | 102110-62-3 | diss.rml.association.type.EXPERT_ECHA |
| Thallium arsenide | 234-481-5 | 12006-09-6 | diss.rml.association.type.EXPERT_ECHA |
| 2,6-dimethyl-4-(1-naphthyl)pyrylium hexafluoroarsenate | 282-682-1 | 84282-36-0 | diss.rml.association.type.EXPERT_ECHA |
| Disodium 4-[(o-arsonophenyl)azo]-3-hydroxynaphthalene-2,7-disulphonate | 222-993-1 | 3688-92-4 | diss.rml.association.type.EXPERT_ECHA |
| Gallium zinc triarsenide | 308-577-3 | 98106-56-0 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), lead salt | - | 7645-25-2 | diss.rml.association.type.EXPERT |
| Triethyl arsenite | 221-543-1 | 3141-12-6 | diss.rml.association.type.EXPERT_ECHA |
| Disilver arsenide | 274-573-2 | 70333-07-2 | diss.rml.association.type.EXPERT_ECHA |
| Diarsenic tritelluride | 234-955-1 | 12044-54-1 | diss.rml.association.type.EXPERT_ECHA |
| Cobalt arsenide (CoAs3) | - | 12256-04-1 | diss.rml.association.type.EXPERT |
| Lithium hexafluoroarsenate | 249-963-0 | 29935-35-1 | diss.rml.association.type.EXPERT_ECHA |
| Acetarsol sodium | 259-714-8 | 55588-51-7 | diss.rml.association.type.EXPERT |
| Arsenic acid, magnesium salt | 233-285-7 | 10103-50-1 | diss.rml.association.type.EXPERT_ECHA |
| Disodium [4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonate | 222-749-4 | 3599-28-8 | diss.rml.association.type.EXPERT |
| Sodium dioxoarsenate | 232-070-5 | 7784-46-5 | diss.rml.association.type.EXPERT_ECHA |
| Dichloro(phenyl)arsine | 211-791-9 | 696-28-6 | diss.rml.association.type.EXPERT |
| Holmium arsenide | 234-476-8 | 12005-92-4 | diss.rml.association.type.EXPERT_ECHA |
| Tetraphenylarsonium bromide | 208-069-0 | 507-27-7 | diss.rml.association.type.EXPERT |
| [No public or meaningful name is available] | - | 37337-11-4 | diss.rml.association.type.EXPERT |
| Zinc arsenate | 236-683-9 | 13464-44-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsonic acid, methyl-, iron salt (9CI) | - | 33972-75-7 | diss.rml.association.type.EXPERT |
| Mercury hydrogenarsenate | 232-062-1 | 7784-37-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, zinc salt | - | 10326-24-6 | diss.rml.association.type.EXPERT |
| Arsonic acid, monoammonium salt | - | 54058-01-4 | diss.rml.association.type.EXPERT |
| Cobalt arsenide | 248-168-6 | 27016-73-5 | diss.rml.association.type.EXPERT_ECHA |
| Chlorodiphenylarsine | 211-921-4 | 712-48-1 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), dipotassium salt | - | 21093-83-4 | diss.rml.association.type.EXPERT |
| Zirconium arsenide | 262-524-8 | 60909-47-9 | diss.rml.association.type.EXPERT_ECHA |
| 6,6'-dihydroxy-3,3'-diarsene-1,2-diyldianilinium dichloride | 205-386-6 | 139-93-5 | diss.rml.association.type.EXPERT_ECHA |
| Dichromium arsenide | 235-499-6 | 12254-85-2 | diss.rml.association.type.EXPERT_ECHA |
| Diphenylarsinecarbonitrile | 245-716-6 | 23525-22-6 | diss.rml.association.type.EXPERT |
| Arsenic acid | 231-901-9 | 7778-39-4 | diss.rml.association.type.EXPERT_ECHA |
| Trisilver arsenate | 236-841-7 | 13510-44-6 | diss.rml.association.type.EXPERT_ECHA |
| 4-(2-chloroacetamido)phenylarsonic acid | 226-569-7 | 5425-62-7 | diss.rml.association.type.EXPERT |
| Triphenylarsine oxide | 214-571-0 | 1153-05-5 | diss.rml.association.type.EXPERT |
|
Slimes and Sludges, copper electrolytic refining, decopperized, arsenic-rich
Product obtained by centrifuging the slime discharged at the bases of cells for decopperization of electrolytic copper solutions. Composed primarily of a copper powder rich in arsenic.
|
309-772-6 | 100995-81-1 | diss.rml.association.type.EXPERT_ECHA |
| Sodium p-arsonobenzenesulphonate | 229-632-7 | 6634-88-4 | diss.rml.association.type.EXPERT |
| Phenylarsonic acid | 202-631-9 | 98-05-5 | diss.rml.association.type.EXPERT |
| 4-(diethylamino)-2-ethoxybenzenediazonium hexafluoroarsenate | 264-027-1 | 63217-33-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsine, bis(2-chlorovinyl)chloro- | - | 40334-69-8 | diss.rml.association.type.EXPERT |
| Oxophenarsine | 206-178-8 | 306-12-7 | diss.rml.association.type.EXPERT_ECHA |
| Diarsenic acid | - | 13453-15-1 | diss.rml.association.type.EXPERT |
| 4-(glycolloylamino)phenylarsonic acid | 205-643-2 | 144-87-6 | diss.rml.association.type.EXPERT |
| Cobalt arsenide (CoAs2) | - | 12044-42-7 | diss.rml.association.type.EXPERT |
| Vanadium(4+) diarsenate (1:1) | 308-917-0 | 99035-51-5 | diss.rml.association.type.EXPERT_ECHA |
EU Privacy Disclaimer
This website uses cookies to ensure you get the best experience on our websites.