Registration Dossier

IUPAC name:
(2R,3S,4R,5R,8R,10R,11R,12S,13S,14R)-13-[(2,6-dideoxy-3-C-methyl-3-O-methyl-α-L-erythro-hexopyranosyl-4-ulose)oxy]-2-ethyl-3,4,10-trihydroxy-3,5,8,10,12,14-hexamethyl-15-oxo-1-oxa-6-azacyclopentadecan-11-yl 2-O-[(benzyloxy)carbonyl]-3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranoside trifluoroacetate (1:2)

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C49H76F6N2O18
Molecular weight:
ca. 1 095
SMILES notation:
C[C@@]1(OC)CC(O[C@@H](C)C1=O)O[C@H]1[C@H](C)C(O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2OC(=O)OCc2ccccc2)[C@](C)(O)C[C@@H](C)CN[C@H](C)[C@@H](O)[C@](C)(O)[C@@H](CC)OC(=O)[C@@H]1C
Structural formula:
Chemical structure

Related substances