Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2-thienylacetyl chloride

Inventory

EC number:
254-290-0
EC name:
2-thienylacetyl chloride
CAS number:
39098-97-0
CAS number:
39098-97-0
Synonyms
Names:
Identifier:
IUPAC name
2-thiophen-2-ylacetyl chloride
Thiophene-2 acetylchloride

Molecular and structural information

Molecular formula:
C6H5ClOS
Molecular weight:
ca. 160.62
SMILES notation:
C1=CSC(=C1)CC(=O)Cl
InChl:
InChI=1S/C6H5ClOS/c7-6(8)4-5-2-1-3-9-5/h1-3H,4H2
Structural formula:
Chemical structure

Related substances