Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
[4-(2-benzoyl-4-chlorophenyl)-5-methyl-4H-1,2,4-triazol-3-yl]methanol

Inventory

EC number:
253-805-6
EC name:
5-chloro-2-[3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl]benzophenone
CAS number:
38150-27-5
CAS number:
38150-27-5
Synonyms
Names:
{5-chloro-2-[3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl]phenyl}(phenyl)methanone

Molecular and structural information

Molecular formula:
C17H14ClN3O2
Molecular weight:
327.765
SMILES notation:
Cc1nnc(CO)n1c2ccc(Cl)cc2C(=O)c3ccccc3
InChl:
InChI=1/C17H14ClN3O2/c1-11-19-20-16(10-22)21(11)15-8-7-13(18)9-14(15)17(23)12-5-3-2-4-6-12/h2-9,22H,10H2,1H3
Structural formula:
Chemical structure

Related substances