Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
benzyl(triethyl)azanium chloride

Inventory

EC number:
200-270-1
EC name:
Benzyltriethylammonium chloride
CAS number:
56-37-1
CAS number:
56-37-1

Synonyms

Molecular and structural information

Molecular formula:
C13H22N.Cl
Molecular weight:
227.777
SMILES notation:
[N+](CC)(CC)(Cc1ccccc1)CC.[ClH-]
InChl:
1S/C13H22N.ClH/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;/h7-11H,4-6,12H2,1-3H3;1H/q+1;/p-1
Structural formula:
Chemical structure

Related substances