Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2-methyl-N-[2-(2-oxoimidazolidin-1-yl)ethyl]acrylamide

Inventory

EC number:
221-426-5
EC name:
N-[2-(2-oxoimidazolidin-1-yl)ethyl]methacrylamide
CAS number:
3089-19-8
CAS number:
3089-19-8
Synonyms
Names:
2-METHYL-N-(2-(2-OXO-1-IMIDAZOLIDINYL)ETHYL)-2-*
2-Propenamide, 2-methyl-N-[2-(2-oxo-1-imidazolidinyl)ethyl]-

Molecular and structural information

Molecular formula:
C9H15N3O2
Molecular weight:
197.234
SMILES notation:
CC(=C)C(=O)NCCN1CCNC1=O
InChl:
InChI=1/C9H15N3O2/c1-7(2)8(13)10-3-5-12-6-4-11-9(12)14/h1,3-6H2,2H3,(H,10,13)(H,11,14)
Structural formula:
Chemical structure

Related substances